diff --git a/libcontainerd/client_linux.go b/libcontainerd/client_linux.go
index a1d9ca893c..340793724a 100644
--- a/libcontainerd/client_linux.go
+++ b/libcontainerd/client_linux.go
@@ -343,7 +343,7 @@ func (clnt *client) newContainer(dir string, options ...CreateOption) *container
 	}
 	for _, option := range options {
 		if err := option.Apply(container); err != nil {
-			logrus.Error(err)
+			logrus.Errorf("libcontainerd: newContainer(): %v", err)
 		}
 	}
 	return container
@@ -391,7 +391,7 @@ func (clnt *client) restore(cont *containerd.Container, lastEvent *containerd.Ev
 	clnt.lock(cont.Id)
 	defer clnt.unlock(cont.Id)
 
-	logrus.Debugf("restore container %s state %s", cont.Id, cont.Status)
+	logrus.Debugf("libcontainerd: restore container %s state %s", cont.Id, cont.Status)
 
 	containerID := cont.Id
 	if _, err := clnt.getContainer(containerID); err == nil {
@@ -445,7 +445,7 @@ func (clnt *client) restore(cont *containerd.Container, lastEvent *containerd.Ev
 				}})
 		}
 
-		logrus.Warnf("unexpected backlog event: %#v", lastEvent)
+		logrus.Warnf("libcontainerd: unexpected backlog event: %#v", lastEvent)
 	}
 
 	return nil
@@ -526,7 +526,7 @@ func (clnt *client) Restore(containerID string, options ...CreateOption) error {
 	// container is still alive
 	if clnt.liveRestore {
 		if err := clnt.restore(cont, ev, options...); err != nil {
-			logrus.Errorf("error restoring %s: %v", containerID, err)
+			logrus.Errorf("libcontainerd: error restoring %s: %v", containerID, err)
 		}
 		return nil
 	}
@@ -542,12 +542,12 @@ func (clnt *client) Restore(containerID string, options ...CreateOption) error {
 	container.discardFifos()
 
 	if err := clnt.Signal(containerID, int(syscall.SIGTERM)); err != nil {
-		logrus.Errorf("error sending sigterm to %v: %v", containerID, err)
+		logrus.Errorf("libcontainerd: error sending sigterm to %v: %v", containerID, err)
 	}
 	select {
 	case <-time.After(10 * time.Second):
 		if err := clnt.Signal(containerID, int(syscall.SIGKILL)); err != nil {
-			logrus.Errorf("error sending sigkill to %v: %v", containerID, err)
+			logrus.Errorf("libcontainerd: error sending sigkill to %v: %v", containerID, err)
 		}
 		select {
 		case <-time.After(2 * time.Second):
diff --git a/libcontainerd/client_windows.go b/libcontainerd/client_windows.go
index ce2b2b57d5..cfaec46c98 100644
--- a/libcontainerd/client_windows.go
+++ b/libcontainerd/client_windows.go
@@ -38,7 +38,7 @@ const defaultOwner = "docker"
 // Create is the entrypoint to create a container from a spec, and if successfully
 // created, start it too.
 func (clnt *client) Create(containerID string, spec Spec, options ...CreateOption) error {
-	logrus.Debugln("LCD client.Create() with spec", spec)
+	logrus.Debugln("libcontainerd: client.Create() with spec", spec)
 
 	configuration := &hcsshim.ContainerConfig{
 		SystemType: "Container",
@@ -151,20 +151,20 @@ func (clnt *client) Create(containerID string, spec Spec, options ...CreateOptio
 	container.options = options
 	for _, option := range options {
 		if err := option.Apply(container); err != nil {
-			logrus.Error(err)
+			logrus.Errorf("libcontainerd: %v", err)
 		}
 	}
 
 	// Call start, and if it fails, delete the container from our
 	// internal structure, start will keep HCS in sync by deleting the
 	// container there.
-	logrus.Debugf("Create() id=%s, Calling start()", containerID)
+	logrus.Debugf("libcontainerd: Create() id=%s, Calling start()", containerID)
 	if err := container.start(); err != nil {
 		clnt.deleteContainer(containerID)
 		return err
 	}
 
-	logrus.Debugf("Create() id=%s completed successfully", containerID)
+	logrus.Debugf("libcontainerd: Create() id=%s completed successfully", containerID)
 	return nil
 
 }
@@ -203,20 +203,20 @@ func (clnt *client) AddProcess(ctx context.Context, containerID, processFriendly
 	createProcessParms.Environment = setupEnvironmentVariables(procToAdd.Env)
 	createProcessParms.CommandLine = strings.Join(procToAdd.Args, " ")
 
-	logrus.Debugf("commandLine: %s", createProcessParms.CommandLine)
+	logrus.Debugf("libcontainerd: commandLine: %s", createProcessParms.CommandLine)
 
 	// Start the command running in the container.
 	var stdout, stderr io.ReadCloser
 	var stdin io.WriteCloser
 	newProcess, err := container.hcsContainer.CreateProcess(&createProcessParms)
 	if err != nil {
-		logrus.Errorf("AddProcess %s CreateProcess() failed %s", containerID, err)
+		logrus.Errorf("libcontainerd: AddProcess(%s) CreateProcess() failed %s", containerID, err)
 		return err
 	}
 
 	stdin, stdout, stderr, err = newProcess.Stdio()
 	if err != nil {
-		logrus.Errorf("%s getting std pipes failed %s", containerID, err)
+		logrus.Errorf("libcontainerd: %s getting std pipes failed %s", containerID, err)
 		return err
 	}
 
@@ -285,20 +285,20 @@ func (clnt *client) Signal(containerID string, sig int) error {
 
 	cont.manualStopRequested = true
 
-	logrus.Debugf("lcd: Signal() containerID=%s sig=%d pid=%d", containerID, sig, cont.systemPid)
+	logrus.Debugf("libcontainerd: Signal() containerID=%s sig=%d pid=%d", containerID, sig, cont.systemPid)
 
 	if syscall.Signal(sig) == syscall.SIGKILL {
 		// Terminate the compute system
 		if err := cont.hcsContainer.Terminate(); err != nil {
 			if err != hcsshim.ErrVmcomputeOperationPending {
-				logrus.Errorf("Failed to terminate %s - %q", containerID, err)
+				logrus.Errorf("libcontainerd: failed to terminate %s - %q", containerID, err)
 			}
 		}
 	} else {
 		// Terminate Process
 		if err := cont.hcsProcess.Kill(); err != nil {
 			// ignore errors
-			logrus.Warnf("Failed to terminate pid %d in %s: %q", cont.systemPid, containerID, err)
+			logrus.Warnf("libcontainerd: failed to terminate pid %d in %s: %q", cont.systemPid, containerID, err)
 		}
 	}
 
@@ -338,13 +338,13 @@ func (clnt *client) Resize(containerID, processFriendlyName string, width, heigh
 	h, w := uint16(height), uint16(width)
 
 	if processFriendlyName == InitFriendlyName {
-		logrus.Debugln("Resizing systemPID in", containerID, cont.process.systemPid)
+		logrus.Debugln("libcontainerd: resizing systemPID in", containerID, cont.process.systemPid)
 		return cont.process.hcsProcess.ResizeConsole(w, h)
 	}
 
 	for _, p := range cont.processes {
 		if p.friendlyName == processFriendlyName {
-			logrus.Debugln("Resizing exec'd process", containerID, p.systemPid)
+			logrus.Debugln("libcontainerd: resizing exec'd process", containerID, p.systemPid)
 			return p.hcsProcess.ResizeConsole(w, h)
 		}
 	}
@@ -371,7 +371,7 @@ func (clnt *client) Stats(containerID string) (*Stats, error) {
 // Restore is the handler for restoring a container
 func (clnt *client) Restore(containerID string, unusedOnWindows ...CreateOption) error {
 	// TODO Windows: Implement this. For now, just tell the backend the container exited.
-	logrus.Debugf("lcd Restore %s", containerID)
+	logrus.Debugf("libcontainerd: Restore(%s)", containerID)
 	return clnt.backend.StateChanged(containerID, StateInfo{
 		CommonStateInfo: CommonStateInfo{
 			State:    StateExit,
diff --git a/libcontainerd/container_linux.go b/libcontainerd/container_linux.go
index 324905ed41..d6bfc22364 100644
--- a/libcontainerd/container_linux.go
+++ b/libcontainerd/container_linux.go
@@ -67,7 +67,7 @@ func (ctr *container) cleanProcess(id string) {
 	if p, ok := ctr.processes[id]; ok {
 		for _, i := range []int{syscall.Stdin, syscall.Stdout, syscall.Stderr} {
 			if err := os.Remove(p.fifo(i)); err != nil {
-				logrus.Warnf("failed to remove %v for process %v: %v", p.fifo(i), id, err)
+				logrus.Warnf("libcontainerd: failed to remove %v for process %v: %v", p.fifo(i), id, err)
 			}
 		}
 	}
@@ -161,7 +161,7 @@ func (ctr *container) handleEvent(e *containerd.Event) error {
 		if st.State == StateExit && ctr.restartManager != nil {
 			restart, wait, err := ctr.restartManager.ShouldRestart(e.Status, false, time.Since(ctr.startedAt))
 			if err != nil {
-				logrus.Warnf("container %s %v", ctr.containerID, err)
+				logrus.Warnf("libcontainerd: container %s %v", ctr.containerID, err)
 			} else if restart {
 				st.State = StateRestart
 				ctr.restarting = true
@@ -176,11 +176,11 @@ func (ctr *container) handleEvent(e *containerd.Event) error {
 						ctr.clean()
 						ctr.client.q.append(e.Id, func() {
 							if err := ctr.client.backend.StateChanged(e.Id, st); err != nil {
-								logrus.Error(err)
+								logrus.Errorf("libcontainerd: %v", err)
 							}
 						})
 						if err != restartmanager.ErrRestartCanceled {
-							logrus.Error(err)
+							logrus.Errorf("libcontainerd: %v", err)
 						}
 					} else {
 						ctr.start()
@@ -200,7 +200,7 @@ func (ctr *container) handleEvent(e *containerd.Event) error {
 		}
 		ctr.client.q.append(e.Id, func() {
 			if err := ctr.client.backend.StateChanged(e.Id, st); err != nil {
-				logrus.Error(err)
+				logrus.Errorf("libcontainerd: backend.StateChanged(): %v", err)
 			}
 			if e.Type == StatePause || e.Type == StateResume {
 				ctr.pauseMonitor.handle(e.Type)
@@ -213,7 +213,7 @@ func (ctr *container) handleEvent(e *containerd.Event) error {
 		})
 
 	default:
-		logrus.Debugf("event unhandled: %+v", e)
+		logrus.Debugf("libcontainerd: event unhandled: %+v", e)
 	}
 	return nil
 }
diff --git a/libcontainerd/container_windows.go b/libcontainerd/container_windows.go
index 7e36e857ec..23c0c6fe6f 100644
--- a/libcontainerd/container_windows.go
+++ b/libcontainerd/container_windows.go
@@ -47,13 +47,13 @@ func (ctr *container) start() error {
 
 	// Start the container.  If this is a servicing container, this call will block
 	// until the container is done with the servicing execution.
-	logrus.Debugln("Starting container ", ctr.containerID)
+	logrus.Debugln("libcontainerd: starting container ", ctr.containerID)
 	if err = ctr.hcsContainer.Start(); err != nil {
-		logrus.Errorf("Failed to start container: %s", err)
+		logrus.Errorf("libcontainerd: failed to start container: %s", err)
 		if err := ctr.terminate(); err != nil {
-			logrus.Errorf("Failed to cleanup after a failed Start. %s", err)
+			logrus.Errorf("libcontainerd: failed to cleanup after a failed Start. %s", err)
 		} else {
-			logrus.Debugln("Cleaned up after failed Start by calling Terminate")
+			logrus.Debugln("libcontainerd: cleaned up after failed Start by calling Terminate")
 		}
 		return err
 	}
@@ -79,11 +79,11 @@ func (ctr *container) start() error {
 	// Start the command running in the container.
 	hcsProcess, err := ctr.hcsContainer.CreateProcess(createProcessParms)
 	if err != nil {
-		logrus.Errorf("CreateProcess() failed %s", err)
+		logrus.Errorf("libcontainerd: CreateProcess() failed %s", err)
 		if err := ctr.terminate(); err != nil {
-			logrus.Errorf("Failed to cleanup after a failed CreateProcess. %s", err)
+			logrus.Errorf("libcontainerd: failed to cleanup after a failed CreateProcess. %s", err)
 		} else {
-			logrus.Debugln("Cleaned up after failed CreateProcess by calling Terminate")
+			logrus.Debugln("libcontainerd: cleaned up after failed CreateProcess by calling Terminate")
 		}
 		return err
 	}
@@ -100,7 +100,7 @@ func (ctr *container) start() error {
 		exitCode := ctr.waitProcessExitCode(&ctr.process)
 
 		if exitCode != 0 {
-			logrus.Warnf("Servicing container %s returned non-zero exit code %d", ctr.containerID, exitCode)
+			logrus.Warnf("libcontainerd: servicing container %s returned non-zero exit code %d", ctr.containerID, exitCode)
 			return ctr.terminate()
 		}
 
@@ -111,9 +111,9 @@ func (ctr *container) start() error {
 	var stdin io.WriteCloser
 	stdin, stdout, stderr, err = hcsProcess.Stdio()
 	if err != nil {
-		logrus.Errorf("failed to get stdio pipes: %s", err)
+		logrus.Errorf("libcontainerd: failed to get stdio pipes: %s", err)
 		if err := ctr.terminate(); err != nil {
-			logrus.Errorf("Failed to cleanup after a failed Stdio. %s", err)
+			logrus.Errorf("libcontainerd: failed to cleanup after a failed Stdio. %s", err)
 		}
 		return err
 	}
@@ -134,7 +134,7 @@ func (ctr *container) start() error {
 	}
 
 	// Save the PID
-	logrus.Debugf("Process started - PID %d", pid)
+	logrus.Debugf("libcontainerd: process started - PID %d", pid)
 	ctr.systemPid = uint32(pid)
 
 	// Spin up a go routine waiting for exit to handle cleanup
@@ -163,7 +163,7 @@ func (ctr *container) waitProcessExitCode(process *process) int {
 	err := process.hcsProcess.Wait()
 	if err != nil {
 		if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != syscall.ERROR_BROKEN_PIPE {
-			logrus.Warnf("Wait failed (container may have been killed): %s", err)
+			logrus.Warnf("libcontainerd: Wait() failed (container may have been killed): %s", err)
 		}
 		// Fall through here, do not return. This ensures we attempt to continue the
 		// shutdown in HCS and tell the docker engine that the process/container
@@ -173,7 +173,7 @@ func (ctr *container) waitProcessExitCode(process *process) int {
 	exitCode, err := process.hcsProcess.ExitCode()
 	if err != nil {
 		if herr, ok := err.(*hcsshim.ProcessError); ok && herr.Err != syscall.ERROR_BROKEN_PIPE {
-			logrus.Warnf("Unable to get exit code from container %s", ctr.containerID)
+			logrus.Warnf("libcontainerd: unable to get exit code from container %s", ctr.containerID)
 		}
 		// Fall through here, do not return. This ensures we attempt to continue the
 		// shutdown in HCS and tell the docker engine that the process/container
@@ -181,7 +181,7 @@ func (ctr *container) waitProcessExitCode(process *process) int {
 	}
 
 	if err := process.hcsProcess.Close(); err != nil {
-		logrus.Error(err)
+		logrus.Errorf("libcontainerd: hcsProcess.Close(): %v", err)
 	}
 
 	return exitCode
@@ -191,7 +191,7 @@ func (ctr *container) waitProcessExitCode(process *process) int {
 // equivalent to (in the linux containerd world) where events come in for
 // state change notifications from containerd.
 func (ctr *container) waitExit(process *process, isFirstProcessToStart bool) error {
-	logrus.Debugln("waitExit on pid", process.systemPid)
+	logrus.Debugln("libcontainerd: waitExit() on pid", process.systemPid)
 
 	exitCode := ctr.waitProcessExitCode(process)
 
@@ -212,16 +212,16 @@ func (ctr *container) waitExit(process *process, isFirstProcessToStart bool) err
 	} else {
 		updatePending, err := ctr.hcsContainer.HasPendingUpdates()
 		if err != nil {
-			logrus.Warnf("HasPendingUpdates failed (container may have been killed): %s", err)
+			logrus.Warnf("libcontainerd: HasPendingUpdates() failed (container may have been killed): %s", err)
 		} else {
 			si.UpdatePending = updatePending
 		}
 
-		logrus.Debugf("Shutting down container %s", ctr.containerID)
+		logrus.Debugf("libcontainerd: shutting down container %s", ctr.containerID)
 		if err := ctr.shutdown(); err != nil {
-			logrus.Debugf("Failed to shutdown container %s", ctr.containerID)
+			logrus.Debugf("libcontainerd: failed to shutdown container %s", ctr.containerID)
 		} else {
-			logrus.Debugf("Completed shutting down container %s", ctr.containerID)
+			logrus.Debugf("libcontainerd: completed shutting down container %s", ctr.containerID)
 		}
 		if err := ctr.hcsContainer.Close(); err != nil {
 			logrus.Error(err)
@@ -259,12 +259,12 @@ func (ctr *container) waitExit(process *process, isFirstProcessToStart bool) err
 	}
 
 	// Call into the backend to notify it of the state change.
-	logrus.Debugf("waitExit() calling backend.StateChanged %v", si)
+	logrus.Debugf("libcontainerd: waitExit() calling backend.StateChanged %+v", si)
 	if err := ctr.client.backend.StateChanged(ctr.containerID, si); err != nil {
 		logrus.Error(err)
 	}
 
-	logrus.Debugln("waitExit() completed OK")
+	logrus.Debugf("libcontainerd: waitExit() completed OK, %+v", si)
 	return nil
 }
 
@@ -277,7 +277,7 @@ func (ctr *container) shutdown() error {
 	}
 
 	if err != nil {
-		logrus.Debugf("error shutting down container %s %v calling terminate", ctr.containerID, err)
+		logrus.Debugf("libcontainerd: error shutting down container %s %v calling terminate", ctr.containerID, err)
 		if err := ctr.terminate(); err != nil {
 			return err
 		}
@@ -296,6 +296,7 @@ func (ctr *container) terminate() error {
 	}
 
 	if err != nil {
+		logrus.Debugf("libcontainerd: error terminating container %s %v", ctr.containerID, err)
 		return err
 	}
 
diff --git a/libcontainerd/remote_linux.go b/libcontainerd/remote_linux.go
index 4a5ea4f887..57daa7fc7b 100644
--- a/libcontainerd/remote_linux.go
+++ b/libcontainerd/remote_linux.go
@@ -141,7 +141,7 @@ func (r *remote) handleConnectionChange() {
 			break
 		}
 		state = s
-		logrus.Debugf("containerd connection state change: %v", s)
+		logrus.Debugf("libcontainerd: containerd connection state change: %v", s)
 
 		if r.daemonPid != -1 {
 			switch state {
@@ -155,7 +155,7 @@ func (r *remote) handleConnectionChange() {
 					}
 					<-r.daemonWaitCh
 					if err := r.runContainerdDaemon(); err != nil { //FIXME: Handle error
-						logrus.Errorf("error restarting containerd: %v", err)
+						logrus.Errorf("libcontainerd: error restarting containerd: %v", err)
 					}
 				} else {
 					state = grpc.Idle
@@ -290,12 +290,12 @@ func (r *remote) handleEventStream(events containerd.API_EventsClient) {
 				// ignore error if grpc remote connection is closed manually
 				return
 			}
-			logrus.Errorf("failed to receive event from containerd: %v", err)
+			logrus.Errorf("libcontainerd: failed to receive event from containerd: %v", err)
 			go r.startEventsMonitor()
 			return
 		}
 
-		logrus.Debugf("received containerd event: %#v", e)
+		logrus.Debugf("libcontainerd: received containerd event: %#v", e)
 
 		var container *container
 		var c *client
@@ -347,7 +347,7 @@ func (r *remote) runContainerdDaemon() error {
 			return err
 		}
 		if utils.IsProcessAlive(int(pid)) {
-			logrus.Infof("previous instance of containerd still alive (%d)", pid)
+			logrus.Infof("libcontainerd: previous instance of containerd still alive (%d)", pid)
 			r.daemonPid = int(pid)
 			return nil
 		}
@@ -385,7 +385,7 @@ func (r *remote) runContainerdDaemon() error {
 			args = append(args, "--runtime-args")
 			args = append(args, v)
 		}
-		logrus.Debugf("runContainerdDaemon: runtimeArgs: %s", args)
+		logrus.Debugf("libcontainerd: runContainerdDaemon: runtimeArgs: %s", args)
 	}
 
 	cmd := exec.Command(containerdBinary, args...)
@@ -403,7 +403,7 @@ func (r *remote) runContainerdDaemon() error {
 	if err := cmd.Start(); err != nil {
 		return err
 	}
-	logrus.Infof("New containerd process, pid: %d", cmd.Process.Pid)
+	logrus.Infof("libcontainerd: new containerd process, pid: %d", cmd.Process.Pid)
 	if err := setOOMScore(cmd.Process.Pid, r.oomScore); err != nil {
 		utils.KillProcess(cmd.Process.Pid)
 		return err