3634 lines
118 KiB
JavaScript
3634 lines
118 KiB
JavaScript
/* jquery.nicescroll
|
|
-- version 3.6.0
|
|
-- copyright 2014-11-21 InuYaksa*2014
|
|
-- licensed under the MIT
|
|
--
|
|
-- http://nicescroll.areaaperta.com/
|
|
-- https://github.com/inuyaksa/jquery.nicescroll
|
|
--
|
|
*/
|
|
|
|
(function(factory) {
|
|
if (typeof define === 'function' && define.amd) {
|
|
// AMD. Register as anonymous module.
|
|
define(['jquery'], factory);
|
|
} else {
|
|
// Browser globals.
|
|
factory(jQuery);
|
|
}
|
|
}(function(jQuery) {
|
|
"use strict";
|
|
|
|
// globals
|
|
var domfocus = false;
|
|
var mousefocus = false;
|
|
var tabindexcounter = 0;
|
|
var ascrailcounter = 2000;
|
|
var globalmaxzindex = 0;
|
|
|
|
var $ = jQuery; // sandbox
|
|
|
|
// http://stackoverflow.com/questions/2161159/get-script-path
|
|
function getScriptPath() {
|
|
var scripts = document.getElementsByTagName('script');
|
|
var path = scripts[scripts.length - 1].src.split('?')[0];
|
|
return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
|
|
}
|
|
|
|
var vendors = ['webkit','ms','moz','o'];
|
|
|
|
var setAnimationFrame = window.requestAnimationFrame || false;
|
|
var clearAnimationFrame = window.cancelAnimationFrame || false;
|
|
|
|
if (!setAnimationFrame) { // legacy detection
|
|
for (var vx in vendors) {
|
|
var v = vendors[vx];
|
|
if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'];
|
|
if (!clearAnimationFrame) clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
|
|
}
|
|
}
|
|
|
|
var ClsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
|
|
|
|
var _globaloptions = {
|
|
zindex: "auto",
|
|
cursoropacitymin: 0,
|
|
cursoropacitymax: 1,
|
|
cursorcolor: "#424242",
|
|
cursorwidth: "5px",
|
|
cursorborder: "1px solid #fff",
|
|
cursorborderradius: "5px",
|
|
scrollspeed: 60,
|
|
mousescrollstep: 8 * 3,
|
|
touchbehavior: false,
|
|
hwacceleration: true,
|
|
usetransition: true,
|
|
boxzoom: false,
|
|
dblclickzoom: true,
|
|
gesturezoom: true,
|
|
grabcursorenabled: true,
|
|
autohidemode: true,
|
|
background: "",
|
|
iframeautoresize: true,
|
|
cursorminheight: 32,
|
|
preservenativescrolling: true,
|
|
railoffset: false,
|
|
railhoffset: false,
|
|
bouncescroll: true,
|
|
spacebarenabled: true,
|
|
railpadding: {
|
|
top: 0,
|
|
right: 0,
|
|
left: 0,
|
|
bottom: 0
|
|
},
|
|
disableoutline: true,
|
|
horizrailenabled: true,
|
|
railalign: "right",
|
|
railvalign: "bottom",
|
|
enabletranslate3d: true,
|
|
enablemousewheel: true,
|
|
enablekeyboard: true,
|
|
smoothscroll: true,
|
|
sensitiverail: true,
|
|
enablemouselockapi: true,
|
|
// cursormaxheight:false,
|
|
cursorfixedheight: false,
|
|
directionlockdeadzone: 6,
|
|
hidecursordelay: 400,
|
|
nativeparentscrolling: true,
|
|
enablescrollonselection: true,
|
|
overflowx: true,
|
|
overflowy: true,
|
|
cursordragspeed: 0.3,
|
|
rtlmode: "auto",
|
|
cursordragontouch: false,
|
|
oneaxismousemode: "auto",
|
|
scriptpath: getScriptPath(),
|
|
preventmultitouchscrolling: true
|
|
};
|
|
|
|
var browserdetected = false;
|
|
|
|
var getBrowserDetection = function() {
|
|
|
|
if (browserdetected) return browserdetected;
|
|
|
|
var _el = document.createElement('DIV'),
|
|
_style = _el.style,
|
|
_agent = navigator.userAgent,
|
|
_platform = navigator.platform,
|
|
d = {};
|
|
|
|
d.haspointerlock = "pointerLockElement" in document || "webkitPointerLockElement" in document || "mozPointerLockElement" in document;
|
|
|
|
d.isopera = ("opera" in window); // 12-
|
|
d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
|
|
d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
|
|
|
|
d.isie = (("all" in document) && ("attachEvent" in _el) && !d.isopera); //IE10-
|
|
d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
|
|
d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
|
|
d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
|
|
d.isie9 = d.isie && ("performance" in window) && (document.documentMode >= 9);
|
|
d.isie10 = d.isie && ("performance" in window) && (document.documentMode == 10);
|
|
d.isie11 = ("msRequestFullscreen" in _el) && (document.documentMode >= 11); // IE11+
|
|
|
|
d.isie9mobile = /iemobile.9/i.test(_agent); //wp 7.1 mango
|
|
if (d.isie9mobile) d.isie9 = false;
|
|
d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(_agent); //wp 7.0
|
|
|
|
d.ismozilla = ("MozAppearance" in _style);
|
|
|
|
d.iswebkit = ("WebkitAppearance" in _style);
|
|
|
|
d.ischrome = ("chrome" in window);
|
|
d.ischrome22 = (d.ischrome && d.haspointerlock);
|
|
d.ischrome26 = (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
|
|
|
|
d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // detection for Chrome Touch Emulation
|
|
d.hasmstouch = (window.MSPointerEvent || false); // IE10 pointer events
|
|
d.hasw3ctouch = (window.PointerEvent || false); //IE11 pointer events, following W3C Pointer Events spec
|
|
|
|
d.ismac = /^mac$/i.test(_platform);
|
|
|
|
d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(_platform));
|
|
d.isios4 = ((d.isios) && !("seal" in Object));
|
|
d.isios7 = ((d.isios)&&("webkitHidden" in document)); //iOS 7+
|
|
|
|
d.isandroid = (/android/i.test(_agent));
|
|
|
|
d.haseventlistener = ("addEventListener" in _el);
|
|
|
|
d.trstyle = false;
|
|
d.hastransform = false;
|
|
d.hastranslate3d = false;
|
|
d.transitionstyle = false;
|
|
d.hastransition = false;
|
|
d.transitionend = false;
|
|
|
|
var a;
|
|
var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
|
|
for (a = 0; a < check.length; a++) {
|
|
if (typeof _style[check[a]] != "undefined") {
|
|
d.trstyle = check[a];
|
|
break;
|
|
}
|
|
}
|
|
d.hastransform = (!!d.trstyle);
|
|
if (d.hastransform) {
|
|
_style[d.trstyle] = "translate3d(1px,2px,3px)";
|
|
d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
|
|
}
|
|
|
|
d.transitionstyle = false;
|
|
d.prefixstyle = '';
|
|
d.transitionend = false;
|
|
check = ['transition', 'webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
|
|
var prefix = ['', '-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
|
|
var evs = ['transitionend', 'webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
|
|
for (a = 0; a < check.length; a++) {
|
|
if (check[a] in _style) {
|
|
d.transitionstyle = check[a];
|
|
d.prefixstyle = prefix[a];
|
|
d.transitionend = evs[a];
|
|
break;
|
|
}
|
|
}
|
|
if (d.ischrome26) { // always use prefix
|
|
d.prefixstyle = prefix[1];
|
|
}
|
|
|
|
d.hastransition = (d.transitionstyle);
|
|
|
|
function detectCursorGrab() {
|
|
var lst = ['-webkit-grab', '-moz-grab', 'grab'];
|
|
if ((d.ischrome && !d.ischrome22) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
|
|
for (var a = 0; a < lst.length; a++) {
|
|
var p = lst[a];
|
|
_style.cursor = p;
|
|
if (_style.cursor == p) return p;
|
|
}
|
|
return 'url(//mail.google.com/mail/images/2/openhand.cur),n-resize'; // thank you google for custom cursor!
|
|
}
|
|
d.cursorgrabvalue = detectCursorGrab();
|
|
|
|
d.hasmousecapture = ("setCapture" in _el);
|
|
|
|
d.hasMutationObserver = (ClsMutationObserver !== false);
|
|
|
|
_el = null; //memory released
|
|
|
|
browserdetected = d;
|
|
|
|
return d;
|
|
};
|
|
|
|
var NiceScrollClass = function(myopt, me) {
|
|
|
|
var self = this;
|
|
|
|
this.version = '3.6.0';
|
|
this.name = 'nicescroll';
|
|
|
|
this.me = me;
|
|
|
|
this.opt = {
|
|
doc: $("body"),
|
|
win: false
|
|
};
|
|
|
|
$.extend(this.opt, _globaloptions); // clone opts
|
|
|
|
// Options for internal use
|
|
this.opt.snapbackspeed = 80;
|
|
|
|
if (myopt || false) {
|
|
for (var a in self.opt) {
|
|
if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
|
|
}
|
|
}
|
|
|
|
this.doc = self.opt.doc;
|
|
this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
|
|
this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
|
|
this.haswrapper = (self.opt.win !== false);
|
|
this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
|
|
this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
|
|
this.body = $("body");
|
|
this.viewport = false;
|
|
|
|
this.isfixed = false;
|
|
|
|
this.iframe = false;
|
|
this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
|
|
|
|
this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
|
|
|
|
this.forcescreen = false; //force to use screen position on events
|
|
|
|
this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
|
|
|
|
// Events jump table
|
|
this.onmousedown = false;
|
|
this.onmouseup = false;
|
|
this.onmousemove = false;
|
|
this.onmousewheel = false;
|
|
this.onkeypress = false;
|
|
this.ongesturezoom = false;
|
|
this.onclick = false;
|
|
|
|
// Nicescroll custom events
|
|
this.onscrollstart = false;
|
|
this.onscrollend = false;
|
|
this.onscrollcancel = false;
|
|
|
|
this.onzoomin = false;
|
|
this.onzoomout = false;
|
|
|
|
// Let's start!
|
|
this.view = false;
|
|
this.page = false;
|
|
|
|
this.scroll = {
|
|
x: 0,
|
|
y: 0
|
|
};
|
|
this.scrollratio = {
|
|
x: 0,
|
|
y: 0
|
|
};
|
|
this.cursorheight = 20;
|
|
this.scrollvaluemax = 0;
|
|
|
|
this.isrtlmode = (this.opt.rtlmode == "auto") ? ((this.win[0] == window ? this.body : this.win).css("direction") == "rtl") : (this.opt.rtlmode === true);
|
|
// this.checkrtlmode = false;
|
|
|
|
this.scrollrunning = false;
|
|
|
|
this.scrollmom = false;
|
|
|
|
this.observer = false; // observer div changes
|
|
this.observerremover = false; // observer on parent for remove detection
|
|
this.observerbody = false; // observer on body for position change
|
|
|
|
do {
|
|
this.id = "ascrail" + (ascrailcounter++);
|
|
} while (document.getElementById(this.id));
|
|
|
|
this.rail = false;
|
|
this.cursor = false;
|
|
this.cursorfreezed = false;
|
|
this.selectiondrag = false;
|
|
|
|
this.zoom = false;
|
|
this.zoomactive = false;
|
|
|
|
this.hasfocus = false;
|
|
this.hasmousefocus = false;
|
|
|
|
this.visibility = true;
|
|
this.railslocked = false; // locked by resize
|
|
this.locked = false; // prevent lost of locked status sets by user
|
|
this.hidden = false; // rails always hidden
|
|
this.cursoractive = true; // user can interact with cursors
|
|
|
|
this.wheelprevented = false; //prevent mousewheel event
|
|
|
|
this.overflowx = self.opt.overflowx;
|
|
this.overflowy = self.opt.overflowy;
|
|
|
|
this.nativescrollingarea = false;
|
|
this.checkarea = 0;
|
|
|
|
this.events = []; // event list for unbind
|
|
|
|
this.saved = {}; // style saved
|
|
|
|
this.delaylist = {};
|
|
this.synclist = {};
|
|
|
|
this.lastdeltax = 0;
|
|
this.lastdeltay = 0;
|
|
|
|
this.detected = getBrowserDetection();
|
|
|
|
var cap = $.extend({}, this.detected);
|
|
|
|
this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
|
|
this.ishwscroll = (this.canhwscroll && self.haswrapper);
|
|
|
|
this.hasreversehr = (this.isrtlmode&&!cap.iswebkit); //RTL mode with reverse horizontal axis
|
|
|
|
this.istouchcapable = false; // desktop devices with touch screen support
|
|
|
|
//## Check WebKit-based desktop with touch support
|
|
//## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
|
|
if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
|
|
this.istouchcapable = true;
|
|
cap.cantouch = false; // parse normal desktop events
|
|
}
|
|
|
|
//## disable MouseLock API on user request
|
|
if (!self.opt.enablemouselockapi) {
|
|
cap.hasmousecapture = false;
|
|
cap.haspointerlock = false;
|
|
}
|
|
|
|
/* deprecated
|
|
this.delayed = function(name, fn, tm, lazy) {
|
|
};
|
|
*/
|
|
|
|
this.debounced = function(name, fn, tm) {
|
|
var dd = self.delaylist[name];
|
|
self.delaylist[name] = fn;
|
|
if (!dd) {
|
|
setTimeout(function() {
|
|
var fn = self.delaylist[name];
|
|
self.delaylist[name] = false;
|
|
fn.call(self);
|
|
}, tm);
|
|
}
|
|
};
|
|
|
|
var _onsync = false;
|
|
|
|
this.synched = function(name, fn) {
|
|
|
|
function requestSync() {
|
|
if (_onsync) return;
|
|
setAnimationFrame(function() {
|
|
_onsync = false;
|
|
for (var nn in self.synclist) {
|
|
var fn = self.synclist[nn];
|
|
if (fn) fn.call(self);
|
|
self.synclist[nn] = false;
|
|
}
|
|
});
|
|
_onsync = true;
|
|
}
|
|
|
|
self.synclist[name] = fn;
|
|
requestSync();
|
|
return name;
|
|
};
|
|
|
|
this.unsynched = function(name) {
|
|
if (self.synclist[name]) self.synclist[name] = false;
|
|
};
|
|
|
|
this.css = function(el, pars) { // save & set
|
|
for (var n in pars) {
|
|
self.saved.css.push([el, n, el.css(n)]);
|
|
el.css(n, pars[n]);
|
|
}
|
|
};
|
|
|
|
this.scrollTop = function(val) {
|
|
return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
|
|
};
|
|
|
|
this.scrollLeft = function(val) {
|
|
return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
|
|
};
|
|
|
|
// derived by by Dan Pupius www.pupius.net
|
|
var BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
|
|
|
|
this.st = st;
|
|
this.ed = ed;
|
|
this.spd = spd;
|
|
|
|
this.p1 = p1 || 0;
|
|
this.p2 = p2 || 1;
|
|
this.p3 = p3 || 0;
|
|
this.p4 = p4 || 1;
|
|
|
|
this.ts = (new Date()).getTime();
|
|
this.df = this.ed - this.st;
|
|
};
|
|
BezierClass.prototype = {
|
|
B2: function(t) {
|
|
return 3 * t * t * (1 - t);
|
|
},
|
|
B3: function(t) {
|
|
return 3 * t * (1 - t) * (1 - t);
|
|
},
|
|
B4: function(t) {
|
|
return (1 - t) * (1 - t) * (1 - t);
|
|
},
|
|
getNow: function() {
|
|
var nw = (new Date()).getTime();
|
|
var pc = 1 - ((nw - this.ts) / this.spd);
|
|
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
|
|
return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
|
|
},
|
|
update: function(ed, spd) {
|
|
this.st = this.getNow();
|
|
this.ed = ed;
|
|
this.spd = spd;
|
|
this.ts = (new Date()).getTime();
|
|
this.df = this.ed - this.st;
|
|
return this;
|
|
}
|
|
};
|
|
|
|
//derived from http://stackoverflow.com/questions/11236090/
|
|
function getMatrixValues() {
|
|
var tr = self.doc.css(cap.trstyle);
|
|
if (tr && (tr.substr(0, 6) == "matrix")) {
|
|
return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
|
|
}
|
|
return false;
|
|
}
|
|
|
|
if (this.ishwscroll) {
|
|
// hw accelerated scroll
|
|
this.doc.translate = {
|
|
x: 0,
|
|
y: 0,
|
|
tx: "0px",
|
|
ty: "0px"
|
|
};
|
|
|
|
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
|
|
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
|
|
|
|
this.getScrollTop = function(last) {
|
|
if (!last) {
|
|
var mtx = getMatrixValues();
|
|
if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
|
|
if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
|
|
}
|
|
return self.doc.translate.y;
|
|
};
|
|
|
|
this.getScrollLeft = function(last) {
|
|
if (!last) {
|
|
var mtx = getMatrixValues();
|
|
if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
|
|
if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
|
|
}
|
|
return self.doc.translate.x;
|
|
};
|
|
|
|
this.notifyScrollEvent = function(el) {
|
|
var e = document.createEvent("UIEvents");
|
|
e.initUIEvent("scroll", false, true, window, 1);
|
|
e.niceevent = true;
|
|
el.dispatchEvent(e);
|
|
};
|
|
|
|
var cxscrollleft = (this.isrtlmode) ? 1 : -1;
|
|
|
|
if (cap.hastranslate3d && self.opt.enabletranslate3d) {
|
|
this.setScrollTop = function(val, silent) {
|
|
self.doc.translate.y = val;
|
|
self.doc.translate.ty = (val * -1) + "px";
|
|
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
|
|
if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
};
|
|
this.setScrollLeft = function(val, silent) {
|
|
self.doc.translate.x = val;
|
|
self.doc.translate.tx = (val * cxscrollleft) + "px";
|
|
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
|
|
if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
};
|
|
} else {
|
|
this.setScrollTop = function(val, silent) {
|
|
self.doc.translate.y = val;
|
|
self.doc.translate.ty = (val * -1) + "px";
|
|
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
|
|
if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
};
|
|
this.setScrollLeft = function(val, silent) {
|
|
self.doc.translate.x = val;
|
|
self.doc.translate.tx = (val * cxscrollleft) + "px";
|
|
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
|
|
if (!silent) self.notifyScrollEvent(self.win[0]);
|
|
};
|
|
}
|
|
} else {
|
|
// native scroll
|
|
this.getScrollTop = function() {
|
|
return self.docscroll.scrollTop();
|
|
};
|
|
this.setScrollTop = function(val) {
|
|
return self.docscroll.scrollTop(val);
|
|
};
|
|
this.getScrollLeft = function() {
|
|
if (self.detected.ismozilla && self.isrtlmode)
|
|
return Math.abs(self.docscroll.scrollLeft());
|
|
return self.docscroll.scrollLeft();
|
|
};
|
|
this.setScrollLeft = function(val) {
|
|
return self.docscroll.scrollLeft((self.detected.ismozilla && self.isrtlmode) ? -val : val);
|
|
};
|
|
}
|
|
|
|
this.getTarget = function(e) {
|
|
if (!e) return false;
|
|
if (e.target) return e.target;
|
|
if (e.srcElement) return e.srcElement;
|
|
return false;
|
|
};
|
|
|
|
this.hasParent = function(e, id) {
|
|
if (!e) return false;
|
|
var el = e.target || e.srcElement || e || false;
|
|
while (el && el.id != id) {
|
|
el = el.parentNode || false;
|
|
}
|
|
return (el !== false);
|
|
};
|
|
|
|
function getZIndex() {
|
|
var dom = self.win;
|
|
if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
|
|
while (dom.length > 0) {
|
|
if (dom[0].nodeType == 9) return false;
|
|
var zi = dom.css('zIndex');
|
|
if (!isNaN(zi) && zi != 0) return parseInt(zi);
|
|
dom = dom.parent();
|
|
}
|
|
return false;
|
|
}
|
|
|
|
//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
|
|
var _convertBorderWidth = {
|
|
"thin": 1,
|
|
"medium": 3,
|
|
"thick": 5
|
|
};
|
|
|
|
function getWidthToPixel(dom, prop, chkheight) {
|
|
var wd = dom.css(prop);
|
|
var px = parseFloat(wd);
|
|
if (isNaN(px)) {
|
|
px = _convertBorderWidth[wd] || 0;
|
|
var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
|
|
if (self.isie8 && px) px += 1;
|
|
return (brd) ? px : 0;
|
|
}
|
|
return px;
|
|
}
|
|
|
|
this.getDocumentScrollOffset = function() {
|
|
return {top:window.pageYOffset||document.documentElement.scrollTop,
|
|
left:window.pageXOffset||document.documentElement.scrollLeft};
|
|
}
|
|
|
|
this.getOffset = function() {
|
|
if (self.isfixed) {
|
|
var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
|
|
var scrl = self.getDocumentScrollOffset();
|
|
ofs.top-=scrl.top;
|
|
ofs.left-=scrl.left;
|
|
return ofs;
|
|
}
|
|
var ww = self.win.offset();
|
|
if (!self.viewport) return ww;
|
|
var vp = self.viewport.offset();
|
|
return {
|
|
top: ww.top - vp.top,// + self.viewport.scrollTop(),
|
|
left: ww.left - vp.left // + self.viewport.scrollLeft()
|
|
};
|
|
};
|
|
|
|
this.updateScrollBar = function(len) {
|
|
if (self.ishwscroll) {
|
|
self.rail.css({ //**
|
|
height: self.win.innerHeight() - (self.opt.railpadding.top + self.opt.railpadding.bottom)
|
|
});
|
|
if (self.railh) self.railh.css({ //**
|
|
width: self.win.innerWidth() - (self.opt.railpadding.left + self.opt.railpadding.right)
|
|
});
|
|
|
|
} else {
|
|
var wpos = self.getOffset();
|
|
var pos = {
|
|
top: wpos.top,
|
|
left: wpos.left - (self.opt.railpadding.left + self.opt.railpadding.right)
|
|
};
|
|
pos.top += getWidthToPixel(self.win, 'border-top-width', true);
|
|
pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
|
|
|
|
var off = self.opt.railoffset;
|
|
if (off) {
|
|
if (off.top) pos.top += off.top;
|
|
if (self.rail.align && off.left) pos.left += off.left;
|
|
}
|
|
|
|
if (!self.railslocked) self.rail.css({
|
|
top: pos.top,
|
|
left: pos.left,
|
|
height: ((len) ? len.h : self.win.innerHeight()) - (self.opt.railpadding.top + self.opt.railpadding.bottom)
|
|
});
|
|
|
|
if (self.zoom) {
|
|
self.zoom.css({
|
|
top: pos.top + 1,
|
|
left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
|
|
});
|
|
}
|
|
|
|
if (self.railh && !self.railslocked) {
|
|
var pos = {
|
|
top: wpos.top,
|
|
left: wpos.left
|
|
};
|
|
var off = self.opt.railhoffset;
|
|
if (!!off) {
|
|
if (!!off.top) pos.top += off.top;
|
|
if (!!off.left) pos.left += off.left;
|
|
}
|
|
var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
|
|
var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
|
|
self.railh.css({
|
|
top: y - (self.opt.railpadding.top + self.opt.railpadding.bottom),
|
|
left: x,
|
|
width: self.railh.width
|
|
});
|
|
}
|
|
|
|
|
|
}
|
|
};
|
|
|
|
this.doRailClick = function(e, dbl, hr) {
|
|
var fn, pg, cur, pos;
|
|
|
|
if (self.railslocked) return;
|
|
self.cancelEvent(e);
|
|
|
|
if (dbl) {
|
|
fn = (hr) ? self.doScrollLeft : self.doScrollTop;
|
|
cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
|
|
fn(cur);
|
|
} else {
|
|
fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
|
|
cur = (hr) ? self.scroll.x : self.scroll.y;
|
|
pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
|
|
pg = (hr) ? self.view.w : self.view.h;
|
|
fn((cur >= pos) ? pg: -pg);// (cur >= pos) ? fn(pg): fn(-pg);
|
|
}
|
|
|
|
};
|
|
|
|
self.hasanimationframe = (setAnimationFrame);
|
|
self.hascancelanimationframe = (clearAnimationFrame);
|
|
|
|
if (!self.hasanimationframe) {
|
|
setAnimationFrame = function(fn) {
|
|
return setTimeout(fn, 15 - Math.floor((+new Date()) / 1000) % 16);
|
|
}; // 1000/60)};
|
|
clearAnimationFrame = clearInterval;
|
|
} else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
|
|
self.cancelAnimationFrame = true;
|
|
};
|
|
|
|
this.init = function() {
|
|
|
|
self.saved.css = [];
|
|
|
|
if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
|
|
if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
|
|
|
|
if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
|
|
'-ms-touch-action': 'none'
|
|
});
|
|
|
|
self.zindex = "auto";
|
|
if (!self.ispage && self.opt.zindex == "auto") {
|
|
self.zindex = getZIndex() || "auto";
|
|
} else {
|
|
self.zindex = self.opt.zindex;
|
|
}
|
|
|
|
if (!self.ispage && self.zindex != "auto") {
|
|
if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex;
|
|
}
|
|
|
|
if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
|
|
self.zindex = "auto";
|
|
}
|
|
|
|
if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
|
|
|
|
var cont = self.docscroll;
|
|
if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
|
|
|
|
if (!cap.isie9mobile) self.css(cont, {
|
|
'overflow-y': 'hidden'
|
|
});
|
|
|
|
if (self.ispage && cap.isie7) {
|
|
if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
|
|
'overflow-y': 'hidden'
|
|
}); //IE7 double scrollbar issue
|
|
else if (self.doc[0].nodeName == 'HTML') self.css($("body"), {
|
|
'overflow-y': 'hidden'
|
|
}); //IE7 double scrollbar issue
|
|
}
|
|
|
|
if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
|
|
"-webkit-overflow-scrolling": "touch"
|
|
}); //force hw acceleration
|
|
|
|
var cursor = $(document.createElement('div'));
|
|
cursor.css({
|
|
position: "relative",
|
|
top: 0,
|
|
"float": "right",
|
|
width: self.opt.cursorwidth,
|
|
height: "0px",
|
|
'background-color': self.opt.cursorcolor,
|
|
border: self.opt.cursorborder,
|
|
'background-clip': 'padding-box',
|
|
'-webkit-border-radius': self.opt.cursorborderradius,
|
|
'-moz-border-radius': self.opt.cursorborderradius,
|
|
'border-radius': self.opt.cursorborderradius
|
|
});
|
|
|
|
cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
|
|
|
|
cursor.addClass('nicescroll-cursors');
|
|
|
|
self.cursor = cursor;
|
|
|
|
var rail = $(document.createElement('div'));
|
|
rail.attr('id', self.id);
|
|
rail.addClass('nicescroll-rails nicescroll-rails-vr');
|
|
|
|
var v, a, kp = ["left","right","top","bottom"]; //**
|
|
for (var n in kp) {
|
|
a = kp[n];
|
|
v = self.opt.railpadding[a];
|
|
(v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;
|
|
}
|
|
|
|
rail.append(cursor);
|
|
|
|
rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth());
|
|
rail.css({
|
|
width: rail.width + "px",
|
|
'zIndex': self.zindex,
|
|
"background": self.opt.background,
|
|
cursor: "default"
|
|
});
|
|
|
|
rail.visibility = true;
|
|
rail.scrollable = true;
|
|
|
|
rail.align = (self.opt.railalign == "left") ? 0 : 1;
|
|
|
|
self.rail = rail;
|
|
|
|
self.rail.drag = false;
|
|
|
|
var zoom = false;
|
|
if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
|
|
zoom = document.createElement('div');
|
|
|
|
self.bind(zoom, "click", self.doZoom);
|
|
self.bind(zoom, "mouseenter", function() {
|
|
self.zoom.css('opacity', self.opt.cursoropacitymax);
|
|
});
|
|
self.bind(zoom, "mouseleave", function() {
|
|
self.zoom.css('opacity', self.opt.cursoropacitymin);
|
|
});
|
|
|
|
self.zoom = $(zoom);
|
|
self.zoom.css({
|
|
"cursor": "pointer",
|
|
'z-index': self.zindex,
|
|
'backgroundImage': 'url(' + self.opt.scriptpath + 'zoomico.png)',
|
|
'height': 18,
|
|
'width': 18,
|
|
'backgroundPosition': '0px 0px'
|
|
});
|
|
if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
|
|
if (cap.cantouch && self.opt.gesturezoom) {
|
|
self.ongesturezoom = function(e) {
|
|
if (e.scale > 1.5) self.doZoomIn(e);
|
|
if (e.scale < 0.8) self.doZoomOut(e);
|
|
return self.cancelEvent(e);
|
|
};
|
|
self.bind(self.win, "gestureend", self.ongesturezoom);
|
|
}
|
|
}
|
|
|
|
// init HORIZ
|
|
|
|
self.railh = false;
|
|
var railh;
|
|
|
|
if (self.opt.horizrailenabled) {
|
|
|
|
self.css(cont, {
|
|
'overflow-x': 'hidden'
|
|
});
|
|
|
|
var cursor = $(document.createElement('div'));
|
|
cursor.css({
|
|
position: "absolute",
|
|
top: 0,
|
|
height: self.opt.cursorwidth,
|
|
width: "0px",
|
|
'background-color': self.opt.cursorcolor,
|
|
border: self.opt.cursorborder,
|
|
'background-clip': 'padding-box',
|
|
'-webkit-border-radius': self.opt.cursorborderradius,
|
|
'-moz-border-radius': self.opt.cursorborderradius,
|
|
'border-radius': self.opt.cursorborderradius
|
|
});
|
|
|
|
if (cap.isieold) cursor.css({'overflow':'hidden'}); //IE6 horiz scrollbar issue
|
|
|
|
cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
|
|
|
|
cursor.addClass('nicescroll-cursors');
|
|
|
|
self.cursorh = cursor;
|
|
|
|
railh = $(document.createElement('div'));
|
|
railh.attr('id', self.id + '-hr');
|
|
railh.addClass('nicescroll-rails nicescroll-rails-hr');
|
|
railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
|
|
railh.css({
|
|
height: railh.height + "px",
|
|
'zIndex': self.zindex,
|
|
"background": self.opt.background
|
|
});
|
|
|
|
railh.append(cursor);
|
|
|
|
railh.visibility = true;
|
|
railh.scrollable = true;
|
|
|
|
railh.align = (self.opt.railvalign == "top") ? 0 : 1;
|
|
|
|
self.railh = railh;
|
|
|
|
self.railh.drag = false;
|
|
|
|
}
|
|
|
|
//
|
|
|
|
if (self.ispage) {
|
|
rail.css({
|
|
position: "fixed",
|
|
top: "0px",
|
|
height: "100%"
|
|
});
|
|
(rail.align) ? rail.css({
|
|
right: "0px"
|
|
}): rail.css({
|
|
left: "0px"
|
|
});
|
|
self.body.append(rail);
|
|
if (self.railh) {
|
|
railh.css({
|
|
position: "fixed",
|
|
left: "0px",
|
|
width: "100%"
|
|
});
|
|
(railh.align) ? railh.css({
|
|
bottom: "0px"
|
|
}): railh.css({
|
|
top: "0px"
|
|
});
|
|
self.body.append(railh);
|
|
}
|
|
} else {
|
|
if (self.ishwscroll) {
|
|
if (self.win.css('position') == 'static') self.css(self.win, {
|
|
'position': 'relative'
|
|
});
|
|
var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
|
|
$(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
|
|
if (self.zoom) {
|
|
self.zoom.css({
|
|
position: "absolute",
|
|
top: 1,
|
|
right: 0,
|
|
"margin-right": rail.width + 4
|
|
});
|
|
bd.append(self.zoom);
|
|
}
|
|
rail.css({
|
|
position: "absolute",
|
|
top: 0
|
|
});
|
|
(rail.align) ? rail.css({
|
|
right: 0
|
|
}): rail.css({
|
|
left: 0
|
|
});
|
|
bd.append(rail);
|
|
if (railh) {
|
|
railh.css({
|
|
position: "absolute",
|
|
left: 0,
|
|
bottom: 0
|
|
});
|
|
(railh.align) ? railh.css({
|
|
bottom: 0
|
|
}): railh.css({
|
|
top: 0
|
|
});
|
|
bd.append(railh);
|
|
}
|
|
} else {
|
|
self.isfixed = (self.win.css("position") == "fixed");
|
|
var rlpos = (self.isfixed) ? "fixed" : "absolute";
|
|
|
|
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
|
|
if (self.viewport) {
|
|
self.body = self.viewport;
|
|
if ((/fixed|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
|
|
"position": "relative"
|
|
});
|
|
}
|
|
|
|
rail.css({
|
|
position: rlpos
|
|
});
|
|
if (self.zoom) self.zoom.css({
|
|
position: rlpos
|
|
});
|
|
self.updateScrollBar();
|
|
self.body.append(rail);
|
|
if (self.zoom) self.body.append(self.zoom);
|
|
if (self.railh) {
|
|
railh.css({
|
|
position: rlpos
|
|
});
|
|
self.body.append(railh);
|
|
}
|
|
}
|
|
|
|
if (cap.isios) self.css(self.win, {
|
|
'-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
|
|
'-webkit-touch-callout': 'none'
|
|
}); // prevent grey layer on click
|
|
|
|
if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
|
|
if (cap.iswebkit && self.opt.disableoutline) self.win.css({"outline": "none"}); // Webkit outline
|
|
//if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera 12- to test [TODO]
|
|
|
|
}
|
|
|
|
if (self.opt.autohidemode === false) {
|
|
self.autohidedom = false;
|
|
self.rail.css({
|
|
opacity: self.opt.cursoropacitymax
|
|
});
|
|
if (self.railh) self.railh.css({
|
|
opacity: self.opt.cursoropacitymax
|
|
});
|
|
} else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
|
|
self.autohidedom = $().add(self.rail);
|
|
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
|
|
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
|
|
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
|
|
} else if (self.opt.autohidemode == "scroll") {
|
|
self.autohidedom = $().add(self.rail);
|
|
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
|
|
} else if (self.opt.autohidemode == "cursor") {
|
|
self.autohidedom = $().add(self.cursor);
|
|
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
|
|
} else if (self.opt.autohidemode == "hidden") {
|
|
self.autohidedom = false;
|
|
self.hide();
|
|
self.railslocked = false;
|
|
}
|
|
|
|
if (cap.isie9mobile) {
|
|
|
|
self.scrollmom = new ScrollMomentumClass2D(self);
|
|
|
|
self.onmangotouch = function() {
|
|
var py = self.getScrollTop();
|
|
var px = self.getScrollLeft();
|
|
|
|
if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
|
|
|
|
var dfy = py - self.mangotouch.sy;
|
|
var dfx = px - self.mangotouch.sx;
|
|
var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
|
|
if (df == 0) return;
|
|
|
|
var dry = (dfy < 0) ? -1 : 1;
|
|
var drx = (dfx < 0) ? -1 : 1;
|
|
|
|
var tm = +new Date();
|
|
if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
|
|
|
|
if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
|
|
self.scrollmom.stop();
|
|
self.scrollmom.reset(px, py);
|
|
self.mangotouch.sy = py;
|
|
self.mangotouch.ly = py;
|
|
self.mangotouch.sx = px;
|
|
self.mangotouch.lx = px;
|
|
self.mangotouch.dry = dry;
|
|
self.mangotouch.drx = drx;
|
|
self.mangotouch.tm = tm;
|
|
} else {
|
|
|
|
self.scrollmom.stop();
|
|
self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
|
|
self.mangotouch.tm = tm;
|
|
|
|
var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
|
|
self.mangotouch.ly = py;
|
|
self.mangotouch.lx = px;
|
|
|
|
if (ds > 2) {
|
|
self.mangotouch.lazy = setTimeout(function() {
|
|
self.mangotouch.lazy = false;
|
|
self.mangotouch.dry = 0;
|
|
self.mangotouch.drx = 0;
|
|
self.mangotouch.tm = 0;
|
|
self.scrollmom.doMomentum(30);
|
|
}, 100);
|
|
}
|
|
}
|
|
};
|
|
|
|
var top = self.getScrollTop();
|
|
var lef = self.getScrollLeft();
|
|
self.mangotouch = {
|
|
sy: top,
|
|
ly: top,
|
|
dry: 0,
|
|
sx: lef,
|
|
lx: lef,
|
|
drx: 0,
|
|
lazy: false,
|
|
tm: 0
|
|
};
|
|
|
|
self.bind(self.docscroll, "scroll", self.onmangotouch);
|
|
|
|
} else {
|
|
|
|
if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
|
|
|
|
self.scrollmom = new ScrollMomentumClass2D(self);
|
|
|
|
self.ontouchstart = function(e) {
|
|
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
|
|
|
|
self.hasmoving = false;
|
|
|
|
if (!self.railslocked) {
|
|
|
|
var tg;
|
|
if (cap.hasmstouch) {
|
|
tg = (e.target) ? e.target : false;
|
|
while (tg) {
|
|
var nc = $(tg).getNiceScroll();
|
|
if ((nc.length > 0) && (nc[0].me == self.me)) break;
|
|
if (nc.length > 0) return false;
|
|
if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
|
|
tg = (tg.parentNode) ? tg.parentNode : false;
|
|
}
|
|
}
|
|
|
|
self.cancelScroll();
|
|
|
|
tg = self.getTarget(e);
|
|
|
|
if (tg) {
|
|
var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
|
|
if (skp) return self.stopPropagation(e);
|
|
}
|
|
|
|
if (!("clientX" in e) && ("changedTouches" in e)) {
|
|
e.clientX = e.changedTouches[0].clientX;
|
|
e.clientY = e.changedTouches[0].clientY;
|
|
}
|
|
|
|
if (self.forcescreen) {
|
|
var le = e;
|
|
e = {
|
|
"original": (e.original) ? e.original : e
|
|
};
|
|
e.clientX = le.screenX;
|
|
e.clientY = le.screenY;
|
|
}
|
|
|
|
self.rail.drag = {
|
|
x: e.clientX,
|
|
y: e.clientY,
|
|
sx: self.scroll.x,
|
|
sy: self.scroll.y,
|
|
st: self.getScrollTop(),
|
|
sl: self.getScrollLeft(),
|
|
pt: 2,
|
|
dl: false
|
|
};
|
|
|
|
if (self.ispage || !self.opt.directionlockdeadzone) {
|
|
self.rail.drag.dl = "f";
|
|
} else {
|
|
|
|
var view = {
|
|
w: $(window).width(),
|
|
h: $(window).height()
|
|
};
|
|
|
|
var page = {
|
|
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
|
|
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
|
|
};
|
|
|
|
var maxh = Math.max(0, page.h - view.h);
|
|
var maxw = Math.max(0, page.w - view.w);
|
|
|
|
if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
|
|
else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
|
|
else self.rail.drag.ck = false;
|
|
if (!self.rail.drag.ck) self.rail.drag.dl = "f";
|
|
}
|
|
|
|
if (self.opt.touchbehavior && self.isiframe && cap.isie) {
|
|
var wp = self.win.position();
|
|
self.rail.drag.x += wp.left;
|
|
self.rail.drag.y += wp.top;
|
|
}
|
|
|
|
self.hasmoving = false;
|
|
self.lastmouseup = false;
|
|
self.scrollmom.reset(e.clientX, e.clientY);
|
|
|
|
if (!cap.cantouch && !this.istouchcapable && !e.pointerType) {
|
|
|
|
var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
|
|
if (!ip) {
|
|
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
|
|
if (self.opt.touchbehavior) {
|
|
if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
|
|
tg._onclick = tg.onclick;
|
|
tg.onclick = function(e) {
|
|
if (self.hasmoving) return false;
|
|
tg._onclick.call(this, e);
|
|
};
|
|
}
|
|
return self.cancelEvent(e);
|
|
}
|
|
return self.stopPropagation(e);
|
|
}
|
|
|
|
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
|
|
pc = {
|
|
"tg": tg,
|
|
"click": false
|
|
};
|
|
self.preventclick = pc;
|
|
}
|
|
|
|
}
|
|
}
|
|
|
|
};
|
|
|
|
self.ontouchend = function(e) {
|
|
if (!self.rail.drag) return true;
|
|
if (self.rail.drag.pt == 2) {
|
|
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
|
|
self.scrollmom.doMomentum();
|
|
self.rail.drag = false;
|
|
if (self.hasmoving) {
|
|
self.lastmouseup = true;
|
|
self.hideCursor();
|
|
if (cap.hasmousecapture) document.releaseCapture();
|
|
if (!cap.cantouch) return self.cancelEvent(e);
|
|
}
|
|
}
|
|
else if (self.rail.drag.pt == 1) {
|
|
return self.onmouseup(e);
|
|
}
|
|
|
|
};
|
|
|
|
var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
|
|
|
|
self.ontouchmove = function(e, byiframe) {
|
|
|
|
if (!self.rail.drag) return false;
|
|
|
|
if (e.targetTouches && self.opt.preventmultitouchscrolling) {
|
|
if (e.targetTouches.length > 1) return false; // multitouch
|
|
}
|
|
|
|
if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
|
|
|
|
if (self.rail.drag.pt == 2) {
|
|
if (cap.cantouch && (cap.isios) && (typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
|
|
|
|
self.hasmoving = true;
|
|
|
|
if (self.preventclick && !self.preventclick.click) {
|
|
self.preventclick.click = self.preventclick.tg.onclick || false;
|
|
self.preventclick.tg.onclick = self.onpreventclick;
|
|
}
|
|
|
|
var ev = $.extend({
|
|
"original": e
|
|
}, e);
|
|
e = ev;
|
|
|
|
if (("changedTouches" in e)) {
|
|
e.clientX = e.changedTouches[0].clientX;
|
|
e.clientY = e.changedTouches[0].clientY;
|
|
}
|
|
|
|
if (self.forcescreen) {
|
|
var le = e;
|
|
e = {
|
|
"original": (e.original) ? e.original : e
|
|
};
|
|
e.clientX = le.screenX;
|
|
e.clientY = le.screenY;
|
|
}
|
|
|
|
var ofy,ofx;
|
|
ofx = ofy = 0;
|
|
|
|
if (moveneedoffset && !byiframe) {
|
|
var wp = self.win.position();
|
|
ofx = -wp.left;
|
|
ofy = -wp.top;
|
|
}
|
|
|
|
var fy = e.clientY + ofy;
|
|
var my = (fy - self.rail.drag.y);
|
|
var fx = e.clientX + ofx;
|
|
var mx = (fx - self.rail.drag.x);
|
|
|
|
var ny = self.rail.drag.st - my;
|
|
|
|
if (self.ishwscroll && self.opt.bouncescroll) {
|
|
if (ny < 0) {
|
|
ny = Math.round(ny / 2);
|
|
// fy = 0;
|
|
} else if (ny > self.page.maxh) {
|
|
ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
|
|
// fy = 0;
|
|
}
|
|
} else {
|
|
if (ny < 0) {
|
|
ny = 0;
|
|
fy = 0;
|
|
}
|
|
if (ny > self.page.maxh) {
|
|
ny = self.page.maxh;
|
|
fy = 0;
|
|
}
|
|
}
|
|
|
|
var nx;
|
|
if (self.railh && self.railh.scrollable) {
|
|
nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
|
|
|
|
if (self.ishwscroll && self.opt.bouncescroll) {
|
|
if (nx < 0) {
|
|
nx = Math.round(nx / 2);
|
|
// fx = 0;
|
|
} else if (nx > self.page.maxw) {
|
|
nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
|
|
// fx = 0;
|
|
}
|
|
} else {
|
|
if (nx < 0) {
|
|
nx = 0;
|
|
fx = 0;
|
|
}
|
|
if (nx > self.page.maxw) {
|
|
nx = self.page.maxw;
|
|
fx = 0;
|
|
}
|
|
}
|
|
|
|
}
|
|
|
|
var grabbed = false;
|
|
if (self.rail.drag.dl) {
|
|
grabbed = true;
|
|
if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
|
|
else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
|
|
} else {
|
|
var ay = Math.abs(my);
|
|
var ax = Math.abs(mx);
|
|
var dz = self.opt.directionlockdeadzone;
|
|
if (self.rail.drag.ck == "v") {
|
|
if (ay > dz && (ax <= (ay * 0.3))) {
|
|
self.rail.drag = false;
|
|
return true;
|
|
} else if (ax > dz) {
|
|
self.rail.drag.dl = "f";
|
|
$("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
|
|
}
|
|
} else if (self.rail.drag.ck == "h") {
|
|
if (ax > dz && (ay <= (ax * 0.3))) {
|
|
self.rail.drag = false;
|
|
return true;
|
|
} else if (ay > dz) {
|
|
self.rail.drag.dl = "f";
|
|
$("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
|
|
}
|
|
}
|
|
}
|
|
|
|
self.synched("touchmove", function() {
|
|
if (self.rail.drag && (self.rail.drag.pt == 2)) {
|
|
if (self.prepareTransition) self.prepareTransition(0);
|
|
if (self.rail.scrollable) self.setScrollTop(ny);
|
|
self.scrollmom.update(fx, fy);
|
|
if (self.railh && self.railh.scrollable) {
|
|
self.setScrollLeft(nx);
|
|
self.showCursor(ny, nx);
|
|
} else {
|
|
self.showCursor(ny);
|
|
}
|
|
if (cap.isie10) document.selection.clear();
|
|
}
|
|
});
|
|
|
|
if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
|
|
if (grabbed) return self.cancelEvent(e);
|
|
}
|
|
else if (self.rail.drag.pt == 1) { // drag on cursor
|
|
return self.onmousemove(e);
|
|
}
|
|
|
|
};
|
|
|
|
}
|
|
|
|
self.onmousedown = function(e, hronly) {
|
|
if (self.rail.drag && self.rail.drag.pt != 1) return;
|
|
if (self.railslocked) return self.cancelEvent(e);
|
|
self.cancelScroll();
|
|
self.rail.drag = {
|
|
x: e.clientX,
|
|
y: e.clientY,
|
|
sx: self.scroll.x,
|
|
sy: self.scroll.y,
|
|
pt: 1,
|
|
hr: (!!hronly)
|
|
};
|
|
var tg = self.getTarget(e);
|
|
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
|
|
if (self.isiframe && !cap.hasmousecapture) {
|
|
self.saved.csspointerevents = self.doc.css("pointer-events");
|
|
self.css(self.doc, {
|
|
"pointer-events": "none"
|
|
});
|
|
}
|
|
self.hasmoving = false;
|
|
return self.cancelEvent(e);
|
|
};
|
|
|
|
self.onmouseup = function(e) {
|
|
if (self.rail.drag) {
|
|
if (self.rail.drag.pt != 1) return true;
|
|
if (cap.hasmousecapture) document.releaseCapture();
|
|
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
|
|
self.rail.drag = false;
|
|
//if (!self.rail.active) self.hideCursor();
|
|
if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
|
|
return self.cancelEvent(e);
|
|
}
|
|
};
|
|
|
|
self.onmousemove = function(e) {
|
|
if (self.rail.drag) {
|
|
if (self.rail.drag.pt != 1) return;
|
|
|
|
if (cap.ischrome && e.which == 0) return self.onmouseup(e);
|
|
|
|
self.cursorfreezed = true;
|
|
self.hasmoving = true;
|
|
|
|
if (self.rail.drag.hr) {
|
|
self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
|
|
if (self.scroll.x < 0) self.scroll.x = 0;
|
|
var mw = self.scrollvaluemaxw;
|
|
if (self.scroll.x > mw) self.scroll.x = mw;
|
|
} else {
|
|
self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
|
|
if (self.scroll.y < 0) self.scroll.y = 0;
|
|
var my = self.scrollvaluemax;
|
|
if (self.scroll.y > my) self.scroll.y = my;
|
|
}
|
|
|
|
self.synched('mousemove', function() {
|
|
if (self.rail.drag && (self.rail.drag.pt == 1)) {
|
|
self.showCursor();
|
|
if (self.rail.drag.hr) {
|
|
if (self.hasreversehr) {
|
|
self.doScrollLeft(self.scrollvaluemaxw-Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
|
|
} else {
|
|
self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
|
|
}
|
|
}
|
|
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
|
|
}
|
|
});
|
|
|
|
return self.cancelEvent(e);
|
|
}
|
|
/*
|
|
else {
|
|
self.checkarea = true;
|
|
}
|
|
*/
|
|
};
|
|
|
|
if (cap.cantouch || self.opt.touchbehavior) {
|
|
|
|
self.onpreventclick = function(e) {
|
|
if (self.preventclick) {
|
|
self.preventclick.tg.onclick = self.preventclick.click;
|
|
self.preventclick = false;
|
|
return self.cancelEvent(e);
|
|
}
|
|
}
|
|
|
|
self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
|
|
|
|
self.onclick = (cap.isios) ? false : function(e) {
|
|
if (self.lastmouseup) {
|
|
self.lastmouseup = false;
|
|
return self.cancelEvent(e);
|
|
} else {
|
|
return true;
|
|
}
|
|
};
|
|
|
|
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
|
|
self.css((self.ispage) ? self.doc : self.win, {
|
|
'cursor': cap.cursorgrabvalue
|
|
});
|
|
self.css(self.rail, {
|
|
'cursor': cap.cursorgrabvalue
|
|
});
|
|
}
|
|
|
|
} else {
|
|
|
|
var checkSelectionScroll = function(e) {
|
|
if (!self.selectiondrag) return;
|
|
|
|
if (e) {
|
|
var ww = self.win.outerHeight();
|
|
var df = (e.pageY - self.selectiondrag.top);
|
|
if (df > 0 && df < ww) df = 0;
|
|
if (df >= ww) df -= ww;
|
|
self.selectiondrag.df = df;
|
|
}
|
|
if (self.selectiondrag.df == 0) return;
|
|
|
|
var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
|
|
self.doScrollBy(rt);
|
|
|
|
self.debounced("doselectionscroll", function() {
|
|
checkSelectionScroll()
|
|
}, 50);
|
|
};
|
|
|
|
if ("getSelection" in document) { // A grade - Major browsers
|
|
self.hasTextSelected = function() {
|
|
return (document.getSelection().rangeCount > 0);
|
|
};
|
|
} else if ("selection" in document) { //IE9-
|
|
self.hasTextSelected = function() {
|
|
return (document.selection.type != "None");
|
|
};
|
|
} else {
|
|
self.hasTextSelected = function() { // no support
|
|
return false;
|
|
};
|
|
}
|
|
|
|
self.onselectionstart = function(e) {
|
|
/* More testing - severe chrome issues
|
|
if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
|
|
self.win.css({'overflow':'auto'});
|
|
setTimeout(function(){
|
|
self.win.css({'overflow':''});
|
|
},10);
|
|
return true;
|
|
}
|
|
*/
|
|
if (self.ispage) return;
|
|
self.selectiondrag = self.win.offset();
|
|
};
|
|
|
|
self.onselectionend = function(e) {
|
|
self.selectiondrag = false;
|
|
};
|
|
self.onselectiondrag = function(e) {
|
|
if (!self.selectiondrag) return;
|
|
if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
|
|
checkSelectionScroll(e)
|
|
}, 250);
|
|
};
|
|
|
|
|
|
}
|
|
|
|
if (cap.hasw3ctouch) { //IE11+
|
|
self.css(self.rail, {
|
|
'touch-action': 'none'
|
|
});
|
|
self.css(self.cursor, {
|
|
'touch-action': 'none'
|
|
});
|
|
self.bind(self.win, "pointerdown", self.ontouchstart);
|
|
self.bind(document, "pointerup", self.ontouchend);
|
|
self.bind(document, "pointermove", self.ontouchmove);
|
|
} else if (cap.hasmstouch) { //IE10
|
|
self.css(self.rail, {
|
|
'-ms-touch-action': 'none'
|
|
});
|
|
self.css(self.cursor, {
|
|
'-ms-touch-action': 'none'
|
|
});
|
|
self.bind(self.win, "MSPointerDown", self.ontouchstart);
|
|
self.bind(document, "MSPointerUp", self.ontouchend);
|
|
self.bind(document, "MSPointerMove", self.ontouchmove);
|
|
self.bind(self.cursor, "MSGestureHold", function(e) {
|
|
e.preventDefault()
|
|
});
|
|
self.bind(self.cursor, "contextmenu", function(e) {
|
|
e.preventDefault()
|
|
});
|
|
} else if (this.istouchcapable) { //desktop with screen touch enabled
|
|
self.bind(self.win, "touchstart", self.ontouchstart);
|
|
self.bind(document, "touchend", self.ontouchend);
|
|
self.bind(document, "touchcancel", self.ontouchend);
|
|
self.bind(document, "touchmove", self.ontouchmove);
|
|
}
|
|
|
|
|
|
if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
|
|
|
|
self.rail.css({
|
|
"cursor": "default"
|
|
});
|
|
self.railh && self.railh.css({
|
|
"cursor": "default"
|
|
});
|
|
|
|
self.jqbind(self.rail, "mouseenter", function() {
|
|
if (!self.ispage && !self.win.is(":visible")) return false;
|
|
if (self.canshowonmouseevent) self.showCursor();
|
|
self.rail.active = true;
|
|
});
|
|
self.jqbind(self.rail, "mouseleave", function() {
|
|
self.rail.active = false;
|
|
if (!self.rail.drag) self.hideCursor();
|
|
});
|
|
|
|
if (self.opt.sensitiverail) {
|
|
self.bind(self.rail, "click", function(e) {
|
|
self.doRailClick(e, false, false)
|
|
});
|
|
self.bind(self.rail, "dblclick", function(e) {
|
|
self.doRailClick(e, true, false)
|
|
});
|
|
self.bind(self.cursor, "click", function(e) {
|
|
self.cancelEvent(e)
|
|
});
|
|
self.bind(self.cursor, "dblclick", function(e) {
|
|
self.cancelEvent(e)
|
|
});
|
|
}
|
|
|
|
if (self.railh) {
|
|
self.jqbind(self.railh, "mouseenter", function() {
|
|
if (!self.ispage && !self.win.is(":visible")) return false;
|
|
if (self.canshowonmouseevent) self.showCursor();
|
|
self.rail.active = true;
|
|
});
|
|
self.jqbind(self.railh, "mouseleave", function() {
|
|
self.rail.active = false;
|
|
if (!self.rail.drag) self.hideCursor();
|
|
});
|
|
|
|
if (self.opt.sensitiverail) {
|
|
self.bind(self.railh, "click", function(e) {
|
|
self.doRailClick(e, false, true)
|
|
});
|
|
self.bind(self.railh, "dblclick", function(e) {
|
|
self.doRailClick(e, true, true)
|
|
});
|
|
self.bind(self.cursorh, "click", function(e) {
|
|
self.cancelEvent(e)
|
|
});
|
|
self.bind(self.cursorh, "dblclick", function(e) {
|
|
self.cancelEvent(e)
|
|
});
|
|
}
|
|
|
|
}
|
|
|
|
}
|
|
|
|
if (!cap.cantouch && !self.opt.touchbehavior) {
|
|
|
|
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
|
|
self.bind(document, "mousemove", self.onmousemove);
|
|
if (self.onclick) self.bind(document, "click", self.onclick);
|
|
|
|
self.bind(self.cursor, "mousedown", self.onmousedown);
|
|
self.bind(self.cursor, "mouseup", self.onmouseup);
|
|
|
|
if (self.railh) {
|
|
self.bind(self.cursorh, "mousedown", function(e) {
|
|
self.onmousedown(e, true)
|
|
});
|
|
self.bind(self.cursorh, "mouseup", self.onmouseup);
|
|
}
|
|
|
|
if (!self.ispage && self.opt.enablescrollonselection) {
|
|
self.bind(self.win[0], "mousedown", self.onselectionstart);
|
|
self.bind(document, "mouseup", self.onselectionend);
|
|
self.bind(self.cursor, "mouseup", self.onselectionend);
|
|
if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
|
|
self.bind(document, "mousemove", self.onselectiondrag);
|
|
}
|
|
|
|
if (self.zoom) {
|
|
self.jqbind(self.zoom, "mouseenter", function() {
|
|
if (self.canshowonmouseevent) self.showCursor();
|
|
self.rail.active = true;
|
|
});
|
|
self.jqbind(self.zoom, "mouseleave", function() {
|
|
self.rail.active = false;
|
|
if (!self.rail.drag) self.hideCursor();
|
|
});
|
|
}
|
|
|
|
} else {
|
|
|
|
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
|
|
self.bind(document, "mousemove", self.ontouchmove);
|
|
if (self.onclick) self.bind(document, "click", self.onclick);
|
|
|
|
if (self.opt.cursordragontouch) {
|
|
self.bind(self.cursor, "mousedown", self.onmousedown);
|
|
self.bind(self.cursor, "mouseup", self.onmouseup);
|
|
//self.bind(self.cursor, "mousemove", self.onmousemove);
|
|
self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
|
|
self.onmousedown(e, true)
|
|
});
|
|
//self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
|
|
self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
|
|
}
|
|
|
|
}
|
|
|
|
if (self.opt.enablemousewheel) {
|
|
if (!self.isiframe) self.bind((cap.isie && self.ispage) ? document : self.win /*self.docscroll*/ , "mousewheel", self.onmousewheel);
|
|
self.bind(self.rail, "mousewheel", self.onmousewheel);
|
|
if (self.railh) self.bind(self.railh, "mousewheel", self.onmousewheelhr);
|
|
}
|
|
|
|
if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
|
|
if (!self.win.attr("tabindex")) self.win.attr({
|
|
"tabindex": tabindexcounter++
|
|
});
|
|
|
|
self.jqbind(self.win, "focus", function(e) {
|
|
domfocus = (self.getTarget(e)).id || true;
|
|
self.hasfocus = true;
|
|
if (self.canshowonmouseevent) self.noticeCursor();
|
|
});
|
|
self.jqbind(self.win, "blur", function(e) {
|
|
domfocus = false;
|
|
self.hasfocus = false;
|
|
});
|
|
|
|
self.jqbind(self.win, "mouseenter", function(e) {
|
|
mousefocus = (self.getTarget(e)).id || true;
|
|
self.hasmousefocus = true;
|
|
if (self.canshowonmouseevent) self.noticeCursor();
|
|
});
|
|
self.jqbind(self.win, "mouseleave", function() {
|
|
mousefocus = false;
|
|
self.hasmousefocus = false;
|
|
if (!self.rail.drag) self.hideCursor();
|
|
});
|
|
|
|
}
|
|
|
|
} // !ie9mobile
|
|
|
|
//Thanks to http://www.quirksmode.org !!
|
|
self.onkeypress = function(e) {
|
|
if (self.railslocked && self.page.maxh == 0) return true;
|
|
|
|
e = (e) ? e : window.e;
|
|
var tg = self.getTarget(e);
|
|
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
|
|
var tp = tg.getAttribute('type') || tg.type || false;
|
|
if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
|
|
}
|
|
|
|
if ($(tg).attr('contenteditable')) return true;
|
|
|
|
if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
|
|
var key = e.keyCode;
|
|
|
|
if (self.railslocked && key != 27) return self.cancelEvent(e);
|
|
|
|
var ctrl = e.ctrlKey || false;
|
|
var shift = e.shiftKey || false;
|
|
|
|
var ret = false;
|
|
switch (key) {
|
|
case 38:
|
|
case 63233: //safari
|
|
self.doScrollBy(24 * 3);
|
|
ret = true;
|
|
break;
|
|
case 40:
|
|
case 63235: //safari
|
|
self.doScrollBy(-24 * 3);
|
|
ret = true;
|
|
break;
|
|
case 37:
|
|
case 63232: //safari
|
|
if (self.railh) {
|
|
(ctrl) ? self.doScrollLeft(0): self.doScrollLeftBy(24 * 3);
|
|
ret = true;
|
|
}
|
|
break;
|
|
case 39:
|
|
case 63234: //safari
|
|
if (self.railh) {
|
|
(ctrl) ? self.doScrollLeft(self.page.maxw): self.doScrollLeftBy(-24 * 3);
|
|
ret = true;
|
|
}
|
|
break;
|
|
case 33:
|
|
case 63276: // safari
|
|
self.doScrollBy(self.view.h);
|
|
ret = true;
|
|
break;
|
|
case 34:
|
|
case 63277: // safari
|
|
self.doScrollBy(-self.view.h);
|
|
ret = true;
|
|
break;
|
|
case 36:
|
|
case 63273: // safari
|
|
(self.railh && ctrl) ? self.doScrollPos(0, 0): self.doScrollTo(0);
|
|
ret = true;
|
|
break;
|
|
case 35:
|
|
case 63275: // safari
|
|
(self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh): self.doScrollTo(self.page.maxh);
|
|
ret = true;
|
|
break;
|
|
case 32:
|
|
if (self.opt.spacebarenabled) {
|
|
(shift) ? self.doScrollBy(self.view.h): self.doScrollBy(-self.view.h);
|
|
ret = true;
|
|
}
|
|
break;
|
|
case 27: // ESC
|
|
if (self.zoomactive) {
|
|
self.doZoom();
|
|
ret = true;
|
|
}
|
|
break;
|
|
}
|
|
if (ret) return self.cancelEvent(e);
|
|
}
|
|
};
|
|
|
|
if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
|
|
|
|
self.bind(document, "keydown", function(e) {
|
|
var ctrl = e.ctrlKey || false;
|
|
if (ctrl) self.wheelprevented = true;
|
|
});
|
|
self.bind(document, "keyup", function(e) {
|
|
var ctrl = e.ctrlKey || false;
|
|
if (!ctrl) self.wheelprevented = false;
|
|
});
|
|
self.bind(window,"blur",function(e){
|
|
self.wheelprevented = false;
|
|
});
|
|
|
|
self.bind(window, 'resize', self.lazyResize);
|
|
self.bind(window, 'orientationchange', self.lazyResize);
|
|
|
|
self.bind(window, "load", self.lazyResize);
|
|
|
|
if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
|
|
var tmp = self.win.attr("style");
|
|
var ww = parseFloat(self.win.css("width")) + 1;
|
|
self.win.css('width', ww);
|
|
self.synched("chromefix", function() {
|
|
self.win.attr("style", tmp)
|
|
});
|
|
}
|
|
|
|
|
|
// Trying a cross-browser implementation - good luck!
|
|
|
|
self.onAttributeChange = function(e) {
|
|
self.lazyResize(self.isieold ? 250 : 30);
|
|
};
|
|
|
|
if (ClsMutationObserver !== false) {
|
|
self.observerbody = new ClsMutationObserver(function(mutations) {
|
|
mutations.forEach(function(mut){
|
|
if (mut.type=="attributes") {
|
|
return ($("body").hasClass("modal-open")) ? self.hide() : self.show(); // Support for Bootstrap modal
|
|
}
|
|
});
|
|
if (document.body.scrollHeight!=self.page.maxh) return self.lazyResize(30);
|
|
});
|
|
self.observerbody.observe(document.body, {
|
|
childList: true,
|
|
subtree: true,
|
|
characterData: false,
|
|
attributes: true,
|
|
attributeFilter: ['class']
|
|
});
|
|
}
|
|
|
|
if (!self.ispage && !self.haswrapper) {
|
|
// redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
|
|
if (ClsMutationObserver !== false) {
|
|
self.observer = new ClsMutationObserver(function(mutations) {
|
|
mutations.forEach(self.onAttributeChange);
|
|
});
|
|
self.observer.observe(self.win[0], {
|
|
childList: true,
|
|
characterData: false,
|
|
attributes: true,
|
|
subtree: false
|
|
});
|
|
self.observerremover = new ClsMutationObserver(function(mutations) {
|
|
mutations.forEach(function(mo) {
|
|
if (mo.removedNodes.length > 0) {
|
|
for (var dd in mo.removedNodes) {
|
|
if (!!self && (mo.removedNodes[dd] == self.win[0])) return self.remove();
|
|
}
|
|
}
|
|
});
|
|
});
|
|
self.observerremover.observe(self.win[0].parentNode, {
|
|
childList: true,
|
|
characterData: false,
|
|
attributes: false,
|
|
subtree: false
|
|
});
|
|
} else {
|
|
self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
|
|
if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
|
|
self.bind(self.win, "DOMNodeRemoved", function(e) {
|
|
if (e.target == self.win[0]) self.remove();
|
|
});
|
|
}
|
|
}
|
|
|
|
//
|
|
|
|
if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
|
|
if (self.istextarea) self.bind(self.win, "mouseup", self.lazyResize);
|
|
|
|
// self.checkrtlmode = true;
|
|
self.lazyResize(30);
|
|
|
|
}
|
|
|
|
if (this.doc[0].nodeName == 'IFRAME') {
|
|
var oniframeload = function() {
|
|
self.iframexd = false;
|
|
var doc;
|
|
try {
|
|
doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
|
|
var a = doc.domain;
|
|
} catch (e) {
|
|
self.iframexd = true;
|
|
doc = false
|
|
}
|
|
|
|
if (self.iframexd) {
|
|
if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
|
|
return true; //cross-domain - I can't manage this
|
|
}
|
|
|
|
self.forcescreen = true;
|
|
|
|
if (self.isiframe) {
|
|
self.iframe = {
|
|
"doc": $(doc),
|
|
"html": self.doc.contents().find('html')[0],
|
|
"body": self.doc.contents().find('body')[0]
|
|
};
|
|
self.getContentSize = function() {
|
|
return {
|
|
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
|
|
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
|
|
};
|
|
};
|
|
self.docscroll = $(self.iframe.body); //$(this.contentWindow);
|
|
}
|
|
|
|
if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
|
|
self.win.scrollTop(0); // reset position
|
|
self.doc.height(""); //reset height to fix browser bug
|
|
var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
|
|
self.doc.height(hh);
|
|
}
|
|
self.lazyResize(30);
|
|
|
|
if (cap.isie7) self.css($(self.iframe.html), {
|
|
'overflow-y': 'hidden'
|
|
});
|
|
self.css($(self.iframe.body), {
|
|
'overflow-y': 'hidden'
|
|
});
|
|
|
|
if (cap.isios && self.haswrapper) {
|
|
self.css($(doc.body), {
|
|
'-webkit-transform': 'translate3d(0,0,0)'
|
|
}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
|
|
}
|
|
|
|
if ('contentWindow' in this) {
|
|
self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
|
|
} else {
|
|
self.bind(doc, "scroll", self.onscroll);
|
|
}
|
|
|
|
if (self.opt.enablemousewheel) {
|
|
self.bind(doc, "mousewheel", self.onmousewheel);
|
|
}
|
|
|
|
if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
|
|
|
|
if (cap.cantouch || self.opt.touchbehavior) {
|
|
self.bind(doc, "mousedown", self.ontouchstart);
|
|
self.bind(doc, "mousemove", function(e) {
|
|
return self.ontouchmove(e, true)
|
|
});
|
|
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
|
|
'cursor': cap.cursorgrabvalue
|
|
});
|
|
}
|
|
|
|
self.bind(doc, "mouseup", self.ontouchend);
|
|
|
|
if (self.zoom) {
|
|
if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
|
|
if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
|
|
}
|
|
};
|
|
|
|
if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
|
|
setTimeout(function() {
|
|
oniframeload.call(self.doc[0], false)
|
|
}, 500);
|
|
}
|
|
self.bind(this.doc, "load", oniframeload);
|
|
|
|
}
|
|
|
|
};
|
|
|
|
this.showCursor = function(py, px) {
|
|
if (self.cursortimeout) {
|
|
clearTimeout(self.cursortimeout);
|
|
self.cursortimeout = 0;
|
|
}
|
|
if (!self.rail) return;
|
|
if (self.autohidedom) {
|
|
self.autohidedom.stop().css({
|
|
opacity: self.opt.cursoropacitymax
|
|
});
|
|
self.cursoractive = true;
|
|
}
|
|
|
|
if (!self.rail.drag || self.rail.drag.pt != 1) {
|
|
if ((typeof py != "undefined") && (py !== false)) {
|
|
self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
|
|
}
|
|
if (typeof px != "undefined") {
|
|
self.scroll.x = Math.round(px * 1 / self.scrollratio.x);
|
|
}
|
|
}
|
|
|
|
self.cursor.css({
|
|
height: self.cursorheight,
|
|
top: self.scroll.y
|
|
});
|
|
if (self.cursorh) {
|
|
var lx = (self.hasreversehr) ? self.scrollvaluemaxw-self.scroll.x : self.scroll.x;
|
|
(!self.rail.align && self.rail.visibility) ? self.cursorh.css({
|
|
width: self.cursorwidth,
|
|
left: lx + self.rail.width
|
|
}): self.cursorh.css({
|
|
width: self.cursorwidth,
|
|
left: lx
|
|
});
|
|
self.cursoractive = true;
|
|
}
|
|
|
|
if (self.zoom) self.zoom.stop().css({
|
|
opacity: self.opt.cursoropacitymax
|
|
});
|
|
};
|
|
|
|
this.hideCursor = function(tm) {
|
|
if (self.cursortimeout) return;
|
|
if (!self.rail) return;
|
|
if (!self.autohidedom) return;
|
|
if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
|
|
self.cursortimeout = setTimeout(function() {
|
|
if (!self.rail.active || !self.showonmouseevent) {
|
|
self.autohidedom.stop().animate({
|
|
opacity: self.opt.cursoropacitymin
|
|
});
|
|
if (self.zoom) self.zoom.stop().animate({
|
|
opacity: self.opt.cursoropacitymin
|
|
});
|
|
self.cursoractive = false;
|
|
}
|
|
self.cursortimeout = 0;
|
|
}, tm || self.opt.hidecursordelay);
|
|
};
|
|
|
|
this.noticeCursor = function(tm, py, px) {
|
|
self.showCursor(py, px);
|
|
if (!self.rail.active) self.hideCursor(tm);
|
|
};
|
|
|
|
this.getContentSize =
|
|
(self.ispage) ?
|
|
function() {
|
|
return {
|
|
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
|
|
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
|
|
}
|
|
} : (self.haswrapper) ?
|
|
function() {
|
|
return {
|
|
w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
|
|
h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
|
|
}
|
|
} : function() {
|
|
return {
|
|
w: self.docscroll[0].scrollWidth,
|
|
h: self.docscroll[0].scrollHeight
|
|
}
|
|
};
|
|
|
|
this.onResize = function(e, page) {
|
|
|
|
if (!self || !self.win) return false;
|
|
|
|
if (!self.haswrapper && !self.ispage) {
|
|
if (self.win.css('display') == 'none') {
|
|
if (self.visibility) self.hideRail().hideRailHr();
|
|
return false;
|
|
} else {
|
|
if (!self.hidden && !self.visibility) self.showRail().showRailHr();
|
|
}
|
|
}
|
|
|
|
var premaxh = self.page.maxh;
|
|
var premaxw = self.page.maxw;
|
|
|
|
var preview = {
|
|
h: self.view.h,
|
|
w: self.view.w
|
|
};
|
|
|
|
self.view = {
|
|
w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
|
|
h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
|
|
};
|
|
|
|
self.page = (page) ? page : self.getContentSize();
|
|
|
|
self.page.maxh = Math.max(0, self.page.h - self.view.h);
|
|
self.page.maxw = Math.max(0, self.page.w - self.view.w);
|
|
|
|
if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w) && (self.view.h == preview.h)) {
|
|
// test position
|
|
if (!self.ispage) {
|
|
var pos = self.win.offset();
|
|
if (self.lastposition) {
|
|
var lst = self.lastposition;
|
|
if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
|
|
}
|
|
self.lastposition = pos;
|
|
} else {
|
|
return self; //nothing to do
|
|
}
|
|
}
|
|
|
|
if (self.page.maxh == 0) {
|
|
self.hideRail();
|
|
self.scrollvaluemax = 0;
|
|
self.scroll.y = 0;
|
|
self.scrollratio.y = 0;
|
|
self.cursorheight = 0;
|
|
self.setScrollTop(0);
|
|
self.rail.scrollable = false;
|
|
} else {
|
|
self.page.maxh -= (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
|
|
self.rail.scrollable = true;
|
|
}
|
|
|
|
if (self.page.maxw == 0) {
|
|
self.hideRailHr();
|
|
self.scrollvaluemaxw = 0;
|
|
self.scroll.x = 0;
|
|
self.scrollratio.x = 0;
|
|
self.cursorwidth = 0;
|
|
self.setScrollLeft(0);
|
|
self.railh.scrollable = false;
|
|
} else {
|
|
self.page.maxw -= (self.opt.railpadding.left + self.opt.railpadding.right); //**
|
|
self.railh.scrollable = true;
|
|
}
|
|
|
|
self.railslocked = (self.locked) || ((self.page.maxh == 0) && (self.page.maxw == 0));
|
|
if (self.railslocked) {
|
|
if (!self.ispage) self.updateScrollBar(self.view);
|
|
return false;
|
|
}
|
|
|
|
if (!self.hidden && !self.visibility) {
|
|
self.showRail().showRailHr();
|
|
}
|
|
else if (!self.hidden && !self.railh.visibility) self.showRailHr();
|
|
|
|
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
|
|
|
|
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
|
|
self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
|
|
|
|
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
|
|
self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
|
|
|
|
self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder - (self.opt.railpadding.top + self.opt.railpadding.bottom); //**
|
|
|
|
if (self.railh) {
|
|
self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
|
|
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder - (self.opt.railpadding.left + self.opt.railpadding.right); //**
|
|
}
|
|
|
|
/*
|
|
if (self.checkrtlmode&&self.railh) {
|
|
self.checkrtlmode = false;
|
|
if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
|
|
}
|
|
*/
|
|
|
|
if (!self.ispage) self.updateScrollBar(self.view);
|
|
|
|
self.scrollratio = {
|
|
x: (self.page.maxw / self.scrollvaluemaxw),
|
|
y: (self.page.maxh / self.scrollvaluemax)
|
|
};
|
|
|
|
var sy = self.getScrollTop();
|
|
if (sy > self.page.maxh) {
|
|
self.doScrollTop(self.page.maxh);
|
|
} else {
|
|
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
|
|
self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
|
|
if (self.cursoractive) self.noticeCursor();
|
|
}
|
|
|
|
if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
|
|
|
|
return self;
|
|
};
|
|
|
|
this.resize = self.onResize;
|
|
|
|
this.lazyResize = function(tm) { // event debounce
|
|
tm = (isNaN(tm)) ? 30 : tm;
|
|
self.debounced('resize', self.resize, tm);
|
|
return self;
|
|
};
|
|
|
|
// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
|
|
function _modernWheelEvent(dom, name, fn, bubble) {
|
|
self._bind(dom, name, function(e) {
|
|
var e = (e) ? e : window.event;
|
|
var event = {
|
|
original: e,
|
|
target: e.target || e.srcElement,
|
|
type: "wheel",
|
|
deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
|
|
deltaX: 0,
|
|
deltaZ: 0,
|
|
preventDefault: function() {
|
|
e.preventDefault ? e.preventDefault() : e.returnValue = false;
|
|
return false;
|
|
},
|
|
stopImmediatePropagation: function() {
|
|
(e.stopImmediatePropagation) ? e.stopImmediatePropagation(): e.cancelBubble = true;
|
|
}
|
|
};
|
|
|
|
if (name == "mousewheel") {
|
|
event.deltaY = -1 / 40 * e.wheelDelta;
|
|
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
|
|
} else {
|
|
event.deltaY = e.detail;
|
|
}
|
|
|
|
return fn.call(dom, event);
|
|
}, bubble);
|
|
};
|
|
|
|
|
|
|
|
this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
|
|
self.events.push({
|
|
e: dom,
|
|
n: name,
|
|
f: fn,
|
|
q: true
|
|
});
|
|
$(dom).bind(name, fn);
|
|
};
|
|
|
|
this.bind = function(dom, name, fn, bubble) { // touch-oriented & fixing jquery bind
|
|
var el = ("jquery" in dom) ? dom[0] : dom;
|
|
|
|
if (name == 'mousewheel') {
|
|
if (window.addEventListener||'onwheel' in document) { // modern brosers & IE9 detection fix
|
|
self._bind(el, "wheel", fn, bubble || false);
|
|
} else {
|
|
var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
|
|
_modernWheelEvent(el, wname, fn, bubble || false);
|
|
if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
|
|
}
|
|
} else if (el.addEventListener) {
|
|
if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
|
|
var tt = (name == 'mousedown') ? 'touchstart' : (name == 'mouseup') ? 'touchend' : 'touchmove';
|
|
self._bind(el, tt, function(e) {
|
|
if (e.touches) {
|
|
if (e.touches.length < 2) {
|
|
var ev = (e.touches.length) ? e.touches[0] : e;
|
|
ev.original = e;
|
|
fn.call(this, ev);
|
|
}
|
|
} else if (e.changedTouches) {
|
|
var ev = e.changedTouches[0];
|
|
ev.original = e;
|
|
fn.call(this, ev);
|
|
} //blackberry
|
|
}, bubble || false);
|
|
}
|
|
self._bind(el, name, fn, bubble || false);
|
|
if (cap.cantouch && name == "mouseup") self._bind(el, "touchcancel", fn, bubble || false);
|
|
} else {
|
|
self._bind(el, name, function(e) {
|
|
e = e || window.event || false;
|
|
if (e) {
|
|
if (e.srcElement) e.target = e.srcElement;
|
|
}
|
|
if (!("pageY" in e)) {
|
|
e.pageX = e.clientX + document.documentElement.scrollLeft;
|
|
e.pageY = e.clientY + document.documentElement.scrollTop;
|
|
}
|
|
return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
|
|
});
|
|
}
|
|
};
|
|
|
|
if (cap.haseventlistener) { // W3C standard model
|
|
this._bind = function(el, name, fn, bubble) { // primitive bind
|
|
self.events.push({
|
|
e: el,
|
|
n: name,
|
|
f: fn,
|
|
b: bubble,
|
|
q: false
|
|
});
|
|
el.addEventListener(name, fn, bubble || false);
|
|
};
|
|
this.cancelEvent = function(e) {
|
|
if (!e) return false;
|
|
var e = (e.original) ? e.original : e;
|
|
e.preventDefault();
|
|
e.stopPropagation();
|
|
if (e.preventManipulation) e.preventManipulation(); //IE10
|
|
return false;
|
|
};
|
|
this.stopPropagation = function(e) {
|
|
if (!e) return false;
|
|
var e = (e.original) ? e.original : e;
|
|
e.stopPropagation();
|
|
return false;
|
|
};
|
|
this._unbind = function(el, name, fn, bub) { // primitive unbind
|
|
el.removeEventListener(name, fn, bub);
|
|
};
|
|
} else { // old IE model
|
|
this._bind = function(el, name, fn, bubble) { // primitive bind
|
|
self.events.push({
|
|
e: el,
|
|
n: name,
|
|
f: fn,
|
|
b: bubble,
|
|
q: false
|
|
});
|
|
if (el.attachEvent) {
|
|
el.attachEvent("on" + name, fn);
|
|
} else {
|
|
el["on" + name] = fn;
|
|
}
|
|
};
|
|
// Thanks to http://www.switchonthecode.com !!
|
|
this.cancelEvent = function(e) {
|
|
var e = window.event || false;
|
|
if (!e) return false;
|
|
e.cancelBubble = true;
|
|
e.cancel = true;
|
|
e.returnValue = false;
|
|
return false;
|
|
};
|
|
this.stopPropagation = function(e) {
|
|
var e = window.event || false;
|
|
if (!e) return false;
|
|
e.cancelBubble = true;
|
|
return false;
|
|
};
|
|
this._unbind = function(el, name, fn, bub) { // primitive unbind IE old
|
|
if (el.detachEvent) {
|
|
el.detachEvent('on' + name, fn);
|
|
} else {
|
|
el['on' + name] = false;
|
|
}
|
|
};
|
|
}
|
|
|
|
this.unbindAll = function() {
|
|
for (var a = 0; a < self.events.length; a++) {
|
|
var r = self.events[a];
|
|
(r.q) ? r.e.unbind(r.n, r.f): self._unbind(r.e, r.n, r.f, r.b);
|
|
}
|
|
};
|
|
|
|
this.showRail = function() {
|
|
if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
|
|
self.visibility = true;
|
|
self.rail.visibility = true;
|
|
self.rail.css('display', 'block');
|
|
}
|
|
return self;
|
|
};
|
|
|
|
this.showRailHr = function() {
|
|
if (!self.railh) return self;
|
|
if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
|
|
self.railh.visibility = true;
|
|
self.railh.css('display', 'block');
|
|
}
|
|
return self;
|
|
};
|
|
|
|
this.hideRail = function() {
|
|
self.visibility = false;
|
|
self.rail.visibility = false;
|
|
self.rail.css('display', 'none');
|
|
return self;
|
|
};
|
|
|
|
this.hideRailHr = function() {
|
|
if (!self.railh) return self;
|
|
self.railh.visibility = false;
|
|
self.railh.css('display', 'none');
|
|
return self;
|
|
};
|
|
|
|
this.show = function() {
|
|
self.hidden = false;
|
|
self.railslocked = false;
|
|
return self.showRail().showRailHr();
|
|
};
|
|
|
|
this.hide = function() {
|
|
self.hidden = true;
|
|
self.railslocked = true;
|
|
return self.hideRail().hideRailHr();
|
|
};
|
|
|
|
this.toggle = function() {
|
|
return (self.hidden) ? self.show() : self.hide();
|
|
};
|
|
|
|
this.remove = function() {
|
|
self.stop();
|
|
if (self.cursortimeout) clearTimeout(self.cursortimeout);
|
|
self.doZoomOut();
|
|
self.unbindAll();
|
|
|
|
if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
|
|
|
|
if (self.observer !== false) self.observer.disconnect();
|
|
if (self.observerremover !== false) self.observerremover.disconnect();
|
|
if (self.observerbody !== false) self.observerbody.disconnect();
|
|
|
|
self.events = null;
|
|
|
|
if (self.cursor) {
|
|
self.cursor.remove();
|
|
}
|
|
if (self.cursorh) {
|
|
self.cursorh.remove();
|
|
}
|
|
if (self.rail) {
|
|
self.rail.remove();
|
|
}
|
|
if (self.railh) {
|
|
self.railh.remove();
|
|
}
|
|
if (self.zoom) {
|
|
self.zoom.remove();
|
|
}
|
|
for (var a = 0; a < self.saved.css.length; a++) {
|
|
var d = self.saved.css[a];
|
|
d[0].css(d[1], (typeof d[2] == "undefined") ? '' : d[2]);
|
|
}
|
|
self.saved = false;
|
|
self.me.data('__nicescroll', ''); //erase all traces
|
|
|
|
// memory leak fixed by GianlucaGuarini - thanks a lot!
|
|
// remove the current nicescroll from the $.nicescroll array & normalize array
|
|
var lst = $.nicescroll;
|
|
lst.each(function(i) {
|
|
if (!this) return;
|
|
if (this.id === self.id) {
|
|
delete lst[i];
|
|
for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
|
|
lst.length--;
|
|
if (lst.length) delete lst[lst.length];
|
|
}
|
|
});
|
|
|
|
for (var i in self) {
|
|
self[i] = null;
|
|
delete self[i];
|
|
}
|
|
|
|
self = null;
|
|
|
|
};
|
|
|
|
this.scrollstart = function(fn) {
|
|
this.onscrollstart = fn;
|
|
return self;
|
|
};
|
|
this.scrollend = function(fn) {
|
|
this.onscrollend = fn;
|
|
return self;
|
|
};
|
|
this.scrollcancel = function(fn) {
|
|
this.onscrollcancel = fn;
|
|
return self;
|
|
};
|
|
|
|
this.zoomin = function(fn) {
|
|
this.onzoomin = fn;
|
|
return self;
|
|
};
|
|
this.zoomout = function(fn) {
|
|
this.onzoomout = fn;
|
|
return self;
|
|
};
|
|
|
|
this.isScrollable = function(e) {
|
|
var dom = (e.target) ? e.target : e;
|
|
if (dom.nodeName == 'OPTION') return true;
|
|
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
|
|
var dd = $(dom);
|
|
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
|
|
if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
|
|
dom = (dom.parentNode) ? dom.parentNode : false;
|
|
}
|
|
return false;
|
|
};
|
|
|
|
this.getViewport = function(me) {
|
|
var dom = (me && me.parentNode) ? me.parentNode : false;
|
|
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
|
|
var dd = $(dom);
|
|
if (/fixed|absolute/.test(dd.css("position"))) return dd;
|
|
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
|
|
if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
|
|
if (dd.getNiceScroll().length > 0) return dd;
|
|
dom = (dom.parentNode) ? dom.parentNode : false;
|
|
}
|
|
return false; //(dom) ? $(dom) : false;
|
|
};
|
|
|
|
this.triggerScrollEnd = function() {
|
|
if (!self.onscrollend) return;
|
|
|
|
var px = self.getScrollLeft();
|
|
var py = self.getScrollTop();
|
|
|
|
var info = {
|
|
"type": "scrollend",
|
|
"current": {
|
|
"x": px,
|
|
"y": py
|
|
},
|
|
"end": {
|
|
"x": px,
|
|
"y": py
|
|
}
|
|
};
|
|
self.onscrollend.call(self, info);
|
|
}
|
|
|
|
function execScrollWheel(e, hr, chkscroll) {
|
|
var px, py;
|
|
|
|
if (e.deltaMode == 0) { // PIXEL
|
|
px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
|
|
py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
|
|
} else if (e.deltaMode == 1) { // LINE
|
|
px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
|
|
py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
|
|
}
|
|
|
|
if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
|
|
px = py;
|
|
py = 0;
|
|
|
|
if (chkscroll) {
|
|
var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
|
|
if (hrend) { // preserve vertical scrolling
|
|
py = px;
|
|
px = 0;
|
|
}
|
|
}
|
|
|
|
}
|
|
|
|
if (px) {
|
|
if (self.scrollmom) {
|
|
self.scrollmom.stop()
|
|
}
|
|
self.lastdeltax += px;
|
|
self.debounced("mousewheelx", function() {
|
|
var dt = self.lastdeltax;
|
|
self.lastdeltax = 0;
|
|
if (!self.rail.drag) {
|
|
self.doScrollLeftBy(dt)
|
|
}
|
|
}, 15);
|
|
}
|
|
if (py) {
|
|
if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
|
|
if (py < 0) {
|
|
if (self.getScrollTop() >= self.page.maxh) return true;
|
|
} else {
|
|
if (self.getScrollTop() <= 0) return true;
|
|
}
|
|
}
|
|
if (self.scrollmom) {
|
|
self.scrollmom.stop()
|
|
}
|
|
self.lastdeltay += py;
|
|
self.debounced("mousewheely", function() {
|
|
var dt = self.lastdeltay;
|
|
self.lastdeltay = 0;
|
|
if (!self.rail.drag) {
|
|
self.doScrollBy(dt)
|
|
}
|
|
}, 15);
|
|
}
|
|
|
|
e.stopImmediatePropagation();
|
|
return e.preventDefault();
|
|
};
|
|
|
|
this.onmousewheel = function(e) {
|
|
if (self.wheelprevented) return;
|
|
if (self.railslocked) {
|
|
self.debounced("checkunlock", self.resize, 250);
|
|
return true;
|
|
}
|
|
if (self.rail.drag) return self.cancelEvent(e);
|
|
|
|
if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
|
|
|
|
if (self.opt.oneaxismousemode && e.deltaX == 0) {
|
|
if (!self.rail.scrollable) {
|
|
if (self.railh && self.railh.scrollable) {
|
|
return self.onmousewheelhr(e);
|
|
} else {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
|
|
var nw = +(new Date());
|
|
var chk = false;
|
|
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
|
|
self.nativescrollingarea = self.isScrollable(e);
|
|
chk = true;
|
|
}
|
|
self.checkarea = nw;
|
|
if (self.nativescrollingarea) return true; // this isn't my business
|
|
var ret = execScrollWheel(e, false, chk);
|
|
if (ret) self.checkarea = 0;
|
|
return ret;
|
|
};
|
|
|
|
this.onmousewheelhr = function(e) {
|
|
if (self.wheelprevented) return;
|
|
if (self.railslocked || !self.railh.scrollable) return true;
|
|
if (self.rail.drag) return self.cancelEvent(e);
|
|
|
|
var nw = +(new Date());
|
|
var chk = false;
|
|
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
|
|
self.nativescrollingarea = self.isScrollable(e);
|
|
chk = true;
|
|
}
|
|
self.checkarea = nw;
|
|
if (self.nativescrollingarea) return true; // this isn't my business
|
|
if (self.railslocked) return self.cancelEvent(e);
|
|
|
|
return execScrollWheel(e, true, chk);
|
|
};
|
|
|
|
this.stop = function() {
|
|
self.cancelScroll();
|
|
if (self.scrollmon) self.scrollmon.stop();
|
|
self.cursorfreezed = false;
|
|
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
|
|
self.noticeCursor();
|
|
return self;
|
|
};
|
|
|
|
this.getTransitionSpeed = function(dif) {
|
|
var sp = Math.round(self.opt.scrollspeed * 10);
|
|
var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
|
|
return (ex > 20) ? ex : 0;
|
|
};
|
|
|
|
if (!self.opt.smoothscroll) {
|
|
this.doScrollLeft = function(x, spd) { //direct
|
|
var y = self.getScrollTop();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
this.doScrollTop = function(y, spd) { //direct
|
|
var x = self.getScrollLeft();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
this.doScrollPos = function(x, y, spd) { //direct
|
|
var nx = (x > self.page.maxw) ? self.page.maxw : x;
|
|
if (nx < 0) nx = 0;
|
|
var ny = (y > self.page.maxh) ? self.page.maxh : y;
|
|
if (ny < 0) ny = 0;
|
|
self.synched('scroll', function() {
|
|
self.setScrollTop(ny);
|
|
self.setScrollLeft(nx);
|
|
});
|
|
};
|
|
this.cancelScroll = function() {}; // direct
|
|
} else if (self.ishwscroll && cap.hastransition && self.opt.usetransition && !!self.opt.smoothscroll) {
|
|
this.prepareTransition = function(dif, istime) {
|
|
var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
|
|
var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
|
|
if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
|
|
self.lasttransitionstyle = trans;
|
|
self.doc.css(cap.transitionstyle, trans);
|
|
}
|
|
return ex;
|
|
};
|
|
|
|
this.doScrollLeft = function(x, spd) { //trans
|
|
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
|
|
this.doScrollTop = function(y, spd) { //trans
|
|
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
|
|
this.doScrollPos = function(x, y, spd) { //trans
|
|
|
|
var py = self.getScrollTop();
|
|
var px = self.getScrollLeft();
|
|
|
|
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
|
|
|
|
if (self.opt.bouncescroll == false) {
|
|
if (y < 0) y = 0;
|
|
else if (y > self.page.maxh) y = self.page.maxh;
|
|
if (x < 0) x = 0;
|
|
else if (x > self.page.maxw) x = self.page.maxw;
|
|
}
|
|
|
|
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
|
|
|
|
self.newscrolly = y;
|
|
self.newscrollx = x;
|
|
|
|
self.newscrollspeed = spd || false;
|
|
|
|
if (self.timer) return false;
|
|
|
|
self.timer = setTimeout(function() {
|
|
|
|
var top = self.getScrollTop();
|
|
var lft = self.getScrollLeft();
|
|
|
|
var dst = {};
|
|
dst.x = x - lft;
|
|
dst.y = y - top;
|
|
dst.px = lft;
|
|
dst.py = top;
|
|
|
|
var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
|
|
var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
|
|
if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
|
|
|
|
self.prepareTransition(ms, true);
|
|
|
|
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
|
|
if (ms > 0) {
|
|
|
|
if (!self.scrollrunning && self.onscrollstart) {
|
|
var info = {
|
|
"type": "scrollstart",
|
|
"current": {
|
|
"x": lft,
|
|
"y": top
|
|
},
|
|
"request": {
|
|
"x": x,
|
|
"y": y
|
|
},
|
|
"end": {
|
|
"x": self.newscrollx,
|
|
"y": self.newscrolly
|
|
},
|
|
"speed": ms
|
|
};
|
|
self.onscrollstart.call(self, info);
|
|
}
|
|
|
|
if (cap.transitionend) {
|
|
if (!self.scrollendtrapped) {
|
|
self.scrollendtrapped = true;
|
|
self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
|
|
}
|
|
} else {
|
|
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
|
|
self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
|
|
}
|
|
|
|
var py = top;
|
|
var px = lft;
|
|
self.timerscroll = {
|
|
bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
|
|
bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
|
|
};
|
|
if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
|
|
self.showCursor(self.getScrollTop(), self.getScrollLeft())
|
|
}, 60);
|
|
|
|
}
|
|
|
|
self.synched("doScroll-set", function() {
|
|
self.timer = 0;
|
|
if (self.scrollendtrapped) self.scrollrunning = true;
|
|
self.setScrollTop(self.newscrolly);
|
|
self.setScrollLeft(self.newscrollx);
|
|
if (!self.scrollendtrapped) self.onScrollTransitionEnd();
|
|
});
|
|
|
|
|
|
}, 50);
|
|
|
|
};
|
|
|
|
this.cancelScroll = function() {
|
|
if (!self.scrollendtrapped) return true;
|
|
var py = self.getScrollTop();
|
|
var px = self.getScrollLeft();
|
|
self.scrollrunning = false;
|
|
if (!cap.transitionend) clearTimeout(cap.transitionend);
|
|
self.scrollendtrapped = false;
|
|
self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
|
|
self.prepareTransition(0);
|
|
self.setScrollTop(py); // fire event onscroll
|
|
if (self.railh) self.setScrollLeft(px);
|
|
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
self.timerscroll = false;
|
|
|
|
self.cursorfreezed = false;
|
|
|
|
self.showCursor(py, px);
|
|
return self;
|
|
};
|
|
this.onScrollTransitionEnd = function() {
|
|
if (self.scrollendtrapped) self._unbind(self.doc[0], cap.transitionend, self.onScrollTransitionEnd);
|
|
self.scrollendtrapped = false;
|
|
self.prepareTransition(0);
|
|
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
|
|
self.timerscroll = false;
|
|
var py = self.getScrollTop();
|
|
var px = self.getScrollLeft();
|
|
self.setScrollTop(py); // fire event onscroll
|
|
if (self.railh) self.setScrollLeft(px); // fire event onscroll left
|
|
|
|
self.noticeCursor(false, py, px);
|
|
|
|
self.cursorfreezed = false;
|
|
|
|
if (py < 0) py = 0
|
|
else if (py > self.page.maxh) py = self.page.maxh;
|
|
if (px < 0) px = 0
|
|
else if (px > self.page.maxw) px = self.page.maxw;
|
|
if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
|
|
|
|
if (self.onscrollend && self.scrollrunning) {
|
|
self.triggerScrollEnd();
|
|
}
|
|
self.scrollrunning = false;
|
|
|
|
};
|
|
|
|
} else {
|
|
|
|
this.doScrollLeft = function(x, spd) { //no-trans
|
|
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
|
|
this.doScrollTop = function(y, spd) { //no-trans
|
|
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
|
|
self.doScrollPos(x, y, spd);
|
|
};
|
|
|
|
this.doScrollPos = function(x, y, spd) { //no-trans
|
|
var y = ((typeof y == "undefined") || (y === false)) ? self.getScrollTop(true) : y;
|
|
|
|
if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
|
|
|
|
if (self.timer) clearAnimationFrame(self.timer);
|
|
self.timer = 0;
|
|
|
|
var py = self.getScrollTop();
|
|
var px = self.getScrollLeft();
|
|
|
|
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
|
|
|
|
self.newscrolly = y;
|
|
self.newscrollx = x;
|
|
|
|
if (!self.bouncescroll || !self.rail.visibility) {
|
|
if (self.newscrolly < 0) {
|
|
self.newscrolly = 0;
|
|
} else if (self.newscrolly > self.page.maxh) {
|
|
self.newscrolly = self.page.maxh;
|
|
}
|
|
}
|
|
if (!self.bouncescroll || !self.railh.visibility) {
|
|
if (self.newscrollx < 0) {
|
|
self.newscrollx = 0;
|
|
} else if (self.newscrollx > self.page.maxw) {
|
|
self.newscrollx = self.page.maxw;
|
|
}
|
|
}
|
|
|
|
self.dst = {};
|
|
self.dst.x = x - px;
|
|
self.dst.y = y - py;
|
|
self.dst.px = px;
|
|
self.dst.py = py;
|
|
|
|
var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
|
|
|
|
self.dst.ax = self.dst.x / dst;
|
|
self.dst.ay = self.dst.y / dst;
|
|
|
|
var pa = 0;
|
|
var pe = dst;
|
|
|
|
if (self.dst.x == 0) {
|
|
pa = py;
|
|
pe = y;
|
|
self.dst.ay = 1;
|
|
self.dst.py = 0;
|
|
} else if (self.dst.y == 0) {
|
|
pa = px;
|
|
pe = x;
|
|
self.dst.ax = 1;
|
|
self.dst.px = 0;
|
|
}
|
|
|
|
var ms = self.getTransitionSpeed(dst);
|
|
if (spd && spd <= 1) ms *= spd;
|
|
if (ms > 0) {
|
|
self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
|
|
} else {
|
|
self.bzscroll = false;
|
|
}
|
|
|
|
if (self.timer) return;
|
|
|
|
if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
|
|
|
|
var sync = 1;
|
|
|
|
function scrolling() {
|
|
if (self.cancelAnimationFrame) return true;
|
|
|
|
self.scrollrunning = true;
|
|
|
|
sync = 1 - sync;
|
|
if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
|
|
|
|
var done = 0;
|
|
var sx, sy;
|
|
|
|
var sc = sy = self.getScrollTop();
|
|
if (self.dst.ay) {
|
|
sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
|
|
var dr = sc - sy;
|
|
if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
|
|
self.setScrollTop(sc);
|
|
if (sc == self.newscrolly) done = 1;
|
|
} else {
|
|
done = 1;
|
|
}
|
|
|
|
var scx = sx = self.getScrollLeft();
|
|
if (self.dst.ax) {
|
|
scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
|
|
var dr = scx - sx;
|
|
if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
|
|
self.setScrollLeft(scx);
|
|
if (scx == self.newscrollx) done += 1;
|
|
} else {
|
|
done += 1;
|
|
}
|
|
|
|
if (done == 2) {
|
|
self.timer = 0;
|
|
self.cursorfreezed = false;
|
|
self.bzscroll = false;
|
|
self.scrollrunning = false;
|
|
if (sc < 0) sc = 0;
|
|
else if (sc > self.page.maxh) sc = self.page.maxh;
|
|
if (scx < 0) scx = 0;
|
|
else if (scx > self.page.maxw) scx = self.page.maxw;
|
|
if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
|
|
else {
|
|
if (self.onscrollend) {
|
|
self.triggerScrollEnd();
|
|
}
|
|
}
|
|
} else {
|
|
self.timer = setAnimationFrame(scrolling) || 1;
|
|
}
|
|
};
|
|
self.cancelAnimationFrame = false;
|
|
self.timer = 1;
|
|
|
|
if (self.onscrollstart && !self.scrollrunning) {
|
|
var info = {
|
|
"type": "scrollstart",
|
|
"current": {
|
|
"x": px,
|
|
"y": py
|
|
},
|
|
"request": {
|
|
"x": x,
|
|
"y": y
|
|
},
|
|
"end": {
|
|
"x": self.newscrollx,
|
|
"y": self.newscrolly
|
|
},
|
|
"speed": ms
|
|
};
|
|
self.onscrollstart.call(self, info);
|
|
}
|
|
|
|
scrolling();
|
|
|
|
if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
|
|
|
|
self.noticeCursor();
|
|
};
|
|
|
|
this.cancelScroll = function() {
|
|
if (self.timer) clearAnimationFrame(self.timer);
|
|
self.timer = 0;
|
|
self.bzscroll = false;
|
|
self.scrollrunning = false;
|
|
return self;
|
|
};
|
|
|
|
}
|
|
|
|
this.doScrollBy = function(stp, relative) {
|
|
var ny = 0;
|
|
if (relative) {
|
|
ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
|
|
} else {
|
|
var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
|
|
ny = sy - stp;
|
|
}
|
|
if (self.bouncescroll) {
|
|
var haf = Math.round(self.view.h / 2);
|
|
if (ny < -haf) ny = -haf
|
|
else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
|
|
}
|
|
self.cursorfreezed = false;
|
|
|
|
var py = self.getScrollTop(true);
|
|
if (ny < 0 && py <= 0) return self.noticeCursor();
|
|
else if (ny > self.page.maxh && py >= self.page.maxh) {
|
|
self.checkContentSize();
|
|
return self.noticeCursor();
|
|
}
|
|
|
|
self.doScrollTop(ny);
|
|
};
|
|
|
|
this.doScrollLeftBy = function(stp, relative) {
|
|
var nx = 0;
|
|
if (relative) {
|
|
nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
|
|
} else {
|
|
var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
|
|
nx = sx - stp;
|
|
}
|
|
if (self.bouncescroll) {
|
|
var haf = Math.round(self.view.w / 2);
|
|
if (nx < -haf) nx = -haf;
|
|
else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
|
|
}
|
|
self.cursorfreezed = false;
|
|
|
|
var px = self.getScrollLeft(true);
|
|
if (nx < 0 && px <= 0) return self.noticeCursor();
|
|
else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
|
|
|
|
self.doScrollLeft(nx);
|
|
};
|
|
|
|
this.doScrollTo = function(pos, relative) {
|
|
var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
|
|
if (ny < 0) ny = 0;
|
|
else if (ny > self.page.maxh) ny = self.page.maxh;
|
|
self.cursorfreezed = false;
|
|
self.doScrollTop(pos);
|
|
};
|
|
|
|
this.checkContentSize = function() {
|
|
var pg = self.getContentSize();
|
|
if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
|
|
};
|
|
|
|
self.onscroll = function(e) {
|
|
if (self.rail.drag) return;
|
|
if (!self.cursorfreezed) {
|
|
self.synched('scroll', function() {
|
|
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
|
|
if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
|
|
self.noticeCursor();
|
|
});
|
|
}
|
|
};
|
|
self.bind(self.docscroll, "scroll", self.onscroll);
|
|
|
|
this.doZoomIn = function(e) {
|
|
if (self.zoomactive) return;
|
|
self.zoomactive = true;
|
|
|
|
self.zoomrestore = {
|
|
style: {}
|
|
};
|
|
var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
|
|
var win = self.win[0].style;
|
|
for (var a in lst) {
|
|
var pp = lst[a];
|
|
self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
|
|
}
|
|
|
|
self.zoomrestore.style.width = self.win.css('width');
|
|
self.zoomrestore.style.height = self.win.css('height');
|
|
|
|
self.zoomrestore.padding = {
|
|
w: self.win.outerWidth() - self.win.width(),
|
|
h: self.win.outerHeight() - self.win.height()
|
|
};
|
|
|
|
if (cap.isios4) {
|
|
self.zoomrestore.scrollTop = $(window).scrollTop();
|
|
$(window).scrollTop(0);
|
|
}
|
|
|
|
self.win.css({
|
|
"position": (cap.isios4) ? "absolute" : "fixed",
|
|
"top": 0,
|
|
"left": 0,
|
|
"z-index": globalmaxzindex + 100,
|
|
"margin": "0px"
|
|
});
|
|
var bkg = self.win.css("backgroundColor");
|
|
if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
|
|
self.rail.css({
|
|
"z-index": globalmaxzindex + 101
|
|
});
|
|
self.zoom.css({
|
|
"z-index": globalmaxzindex + 102
|
|
});
|
|
self.zoom.css('backgroundPosition', '0px -18px');
|
|
self.resizeZoom();
|
|
|
|
if (self.onzoomin) self.onzoomin.call(self);
|
|
|
|
return self.cancelEvent(e);
|
|
};
|
|
|
|
this.doZoomOut = function(e) {
|
|
if (!self.zoomactive) return;
|
|
self.zoomactive = false;
|
|
|
|
self.win.css("margin", "");
|
|
self.win.css(self.zoomrestore.style);
|
|
|
|
if (cap.isios4) {
|
|
$(window).scrollTop(self.zoomrestore.scrollTop);
|
|
}
|
|
|
|
self.rail.css({
|
|
"z-index": self.zindex
|
|
});
|
|
self.zoom.css({
|
|
"z-index": self.zindex
|
|
});
|
|
self.zoomrestore = false;
|
|
self.zoom.css('backgroundPosition', '0px 0px');
|
|
self.onResize();
|
|
|
|
if (self.onzoomout) self.onzoomout.call(self);
|
|
|
|
return self.cancelEvent(e);
|
|
};
|
|
|
|
this.doZoom = function(e) {
|
|
return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
|
|
};
|
|
|
|
this.resizeZoom = function() {
|
|
if (!self.zoomactive) return;
|
|
|
|
var py = self.getScrollTop(); //preserve scrolling position
|
|
self.win.css({
|
|
width: $(window).width() - self.zoomrestore.padding.w + "px",
|
|
height: $(window).height() - self.zoomrestore.padding.h + "px"
|
|
});
|
|
self.onResize();
|
|
|
|
self.setScrollTop(Math.min(self.page.maxh, py));
|
|
};
|
|
|
|
this.init();
|
|
|
|
$.nicescroll.push(this);
|
|
|
|
};
|
|
|
|
// Inspired by the work of Kin Blas
|
|
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
|
|
|
|
|
|
var ScrollMomentumClass2D = function(nc) {
|
|
var self = this;
|
|
this.nc = nc;
|
|
|
|
this.lastx = 0;
|
|
this.lasty = 0;
|
|
this.speedx = 0;
|
|
this.speedy = 0;
|
|
this.lasttime = 0;
|
|
this.steptime = 0;
|
|
this.snapx = false;
|
|
this.snapy = false;
|
|
this.demulx = 0;
|
|
this.demuly = 0;
|
|
|
|
this.lastscrollx = -1;
|
|
this.lastscrolly = -1;
|
|
|
|
this.chkx = 0;
|
|
this.chky = 0;
|
|
|
|
this.timer = 0;
|
|
|
|
this.time = function() {
|
|
return +new Date(); //beautifull hack
|
|
};
|
|
|
|
this.reset = function(px, py) {
|
|
self.stop();
|
|
var now = self.time();
|
|
self.steptime = 0;
|
|
self.lasttime = now;
|
|
self.speedx = 0;
|
|
self.speedy = 0;
|
|
self.lastx = px;
|
|
self.lasty = py;
|
|
self.lastscrollx = -1;
|
|
self.lastscrolly = -1;
|
|
};
|
|
|
|
this.update = function(px, py) {
|
|
var now = self.time();
|
|
self.steptime = now - self.lasttime;
|
|
self.lasttime = now;
|
|
var dy = py - self.lasty;
|
|
var dx = px - self.lastx;
|
|
var sy = self.nc.getScrollTop();
|
|
var sx = self.nc.getScrollLeft();
|
|
var newy = sy + dy;
|
|
var newx = sx + dx;
|
|
self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
|
|
self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
|
|
self.speedx = dx;
|
|
self.speedy = dy;
|
|
self.lastx = px;
|
|
self.lasty = py;
|
|
};
|
|
|
|
this.stop = function() {
|
|
self.nc.unsynched("domomentum2d");
|
|
if (self.timer) clearTimeout(self.timer);
|
|
self.timer = 0;
|
|
self.lastscrollx = -1;
|
|
self.lastscrolly = -1;
|
|
};
|
|
|
|
this.doSnapy = function(nx, ny) {
|
|
var snap = false;
|
|
|
|
if (ny < 0) {
|
|
ny = 0;
|
|
snap = true;
|
|
} else if (ny > self.nc.page.maxh) {
|
|
ny = self.nc.page.maxh;
|
|
snap = true;
|
|
}
|
|
|
|
if (nx < 0) {
|
|
nx = 0;
|
|
snap = true;
|
|
} else if (nx > self.nc.page.maxw) {
|
|
nx = self.nc.page.maxw;
|
|
snap = true;
|
|
}
|
|
|
|
(snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed): self.nc.triggerScrollEnd();
|
|
};
|
|
|
|
this.doMomentum = function(gp) {
|
|
var t = self.time();
|
|
var l = (gp) ? t + gp : self.lasttime;
|
|
|
|
var sl = self.nc.getScrollLeft();
|
|
var st = self.nc.getScrollTop();
|
|
|
|
var pageh = self.nc.page.maxh;
|
|
var pagew = self.nc.page.maxw;
|
|
|
|
self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
|
|
self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
|
|
|
|
var chk = l && (t - l) <= 60;
|
|
|
|
if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
|
|
|
|
var sy = (self.speedy && chk) ? self.speedy : false;
|
|
var sx = (self.speedx && chk) ? self.speedx : false;
|
|
|
|
if (sy || sx) {
|
|
var tm = Math.max(16, self.steptime); //timeout granularity
|
|
|
|
if (tm > 50) { // do smooth
|
|
var xm = tm / 50;
|
|
self.speedx *= xm;
|
|
self.speedy *= xm;
|
|
tm = 50;
|
|
}
|
|
|
|
self.demulxy = 0;
|
|
|
|
self.lastscrollx = self.nc.getScrollLeft();
|
|
self.chkx = self.lastscrollx;
|
|
self.lastscrolly = self.nc.getScrollTop();
|
|
self.chky = self.lastscrolly;
|
|
|
|
var nx = self.lastscrollx;
|
|
var ny = self.lastscrolly;
|
|
|
|
var onscroll = function() {
|
|
var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
|
|
|
|
if (self.speedx) {
|
|
nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
|
|
self.lastscrollx = nx;
|
|
if ((nx < 0) || (nx > pagew)) df = 0.10;
|
|
}
|
|
|
|
if (self.speedy) {
|
|
ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
|
|
self.lastscrolly = ny;
|
|
if ((ny < 0) || (ny > pageh)) df = 0.10;
|
|
}
|
|
|
|
self.demulxy = Math.min(1, self.demulxy + df);
|
|
|
|
self.nc.synched("domomentum2d", function() {
|
|
|
|
if (self.speedx) {
|
|
var scx = self.nc.getScrollLeft();
|
|
if (scx != self.chkx) self.stop();
|
|
self.chkx = nx;
|
|
self.nc.setScrollLeft(nx);
|
|
}
|
|
|
|
if (self.speedy) {
|
|
var scy = self.nc.getScrollTop();
|
|
if (scy != self.chky) self.stop();
|
|
self.chky = ny;
|
|
self.nc.setScrollTop(ny);
|
|
}
|
|
|
|
if (!self.timer) {
|
|
self.nc.hideCursor();
|
|
self.doSnapy(nx, ny);
|
|
}
|
|
|
|
});
|
|
|
|
if (self.demulxy < 1) {
|
|
self.timer = setTimeout(onscroll, tm);
|
|
} else {
|
|
self.stop();
|
|
self.nc.hideCursor();
|
|
self.doSnapy(nx, ny);
|
|
}
|
|
};
|
|
|
|
onscroll();
|
|
|
|
} else {
|
|
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
|
|
}
|
|
|
|
}
|
|
|
|
};
|
|
|
|
|
|
// override jQuery scrollTop
|
|
|
|
var _scrollTop = jQuery.fn.scrollTop; // preserve original function
|
|
|
|
jQuery.cssHooks["pageYOffset"] = {
|
|
get: function(elem, computed, extra) {
|
|
var nice = $.data(elem, '__nicescroll') || false;
|
|
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
|
|
},
|
|
set: function(elem, value) {
|
|
var nice = $.data(elem, '__nicescroll') || false;
|
|
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call(elem, value);
|
|
return this;
|
|
}
|
|
};
|
|
|
|
/*
|
|
$.fx.step["scrollTop"] = function(fx){
|
|
$.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
|
|
};
|
|
*/
|
|
|
|
jQuery.fn.scrollTop = function(value) {
|
|
if (typeof value == "undefined") {
|
|
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
|
|
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
|
|
} else {
|
|
return this.each(function() {
|
|
var nice = $.data(this, '__nicescroll') || false;
|
|
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)): _scrollTop.call($(this), value);
|
|
});
|
|
}
|
|
};
|
|
|
|
// override jQuery scrollLeft
|
|
|
|
var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
|
|
|
|
$.cssHooks.pageXOffset = {
|
|
get: function(elem, computed, extra) {
|
|
var nice = $.data(elem, '__nicescroll') || false;
|
|
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
|
|
},
|
|
set: function(elem, value) {
|
|
var nice = $.data(elem, '__nicescroll') || false;
|
|
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call(elem, value);
|
|
return this;
|
|
}
|
|
};
|
|
|
|
/*
|
|
$.fx.step["scrollLeft"] = function(fx){
|
|
$.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
|
|
};
|
|
*/
|
|
|
|
jQuery.fn.scrollLeft = function(value) {
|
|
if (typeof value == "undefined") {
|
|
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
|
|
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
|
|
} else {
|
|
return this.each(function() {
|
|
var nice = $.data(this, '__nicescroll') || false;
|
|
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)): _scrollLeft.call($(this), value);
|
|
});
|
|
}
|
|
};
|
|
|
|
var NiceScrollArray = function(doms) {
|
|
var self = this;
|
|
this.length = 0;
|
|
this.name = "nicescrollarray";
|
|
|
|
this.each = function(fn) {
|
|
for (var a = 0, i = 0; a < self.length; a++) fn.call(self[a], i++);
|
|
return self;
|
|
};
|
|
|
|
this.push = function(nice) {
|
|
self[self.length] = nice;
|
|
self.length++;
|
|
};
|
|
|
|
this.eq = function(idx) {
|
|
return self[idx];
|
|
};
|
|
|
|
if (doms) {
|
|
for (var a = 0; a < doms.length; a++) {
|
|
var nice = $.data(doms[a], '__nicescroll') || false;
|
|
if (nice) {
|
|
this[this.length] = nice;
|
|
this.length++;
|
|
}
|
|
};
|
|
}
|
|
|
|
return this;
|
|
};
|
|
|
|
function mplex(el, lst, fn) {
|
|
for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
|
|
};
|
|
mplex(
|
|
NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
|
|
function(e, n) {
|
|
e[n] = function() {
|
|
var args = arguments;
|
|
return this.each(function() {
|
|
this[n].apply(this, args);
|
|
});
|
|
};
|
|
}
|
|
);
|
|
|
|
jQuery.fn.getNiceScroll = function(index) {
|
|
if (typeof index == "undefined") {
|
|
return new NiceScrollArray(this);
|
|
} else {
|
|
var nice = this[index] && $.data(this[index], '__nicescroll') || false;
|
|
return nice;
|
|
}
|
|
};
|
|
|
|
jQuery.extend(jQuery.expr[':'], {
|
|
nicescroll: function(a) {
|
|
return ($.data(a, '__nicescroll')) ? true : false;
|
|
}
|
|
});
|
|
|
|
$.fn.niceScroll = function(wrapper, opt) {
|
|
if (typeof opt == "undefined") {
|
|
if ((typeof wrapper == "object") && !("jquery" in wrapper)) {
|
|
opt = wrapper;
|
|
wrapper = false;
|
|
}
|
|
}
|
|
opt = $.extend({},opt); // cloning
|
|
var ret = new NiceScrollArray();
|
|
if (typeof opt == "undefined") opt = {};
|
|
|
|
if (wrapper || false) {
|
|
opt.doc = $(wrapper);
|
|
opt.win = $(this);
|
|
}
|
|
var docundef = !("doc" in opt);
|
|
if (!docundef && !("win" in opt)) opt.win = $(this);
|
|
|
|
this.each(function() {
|
|
var nice = $(this).data('__nicescroll') || false;
|
|
if (!nice) {
|
|
opt.doc = (docundef) ? $(this) : opt.doc;
|
|
nice = new NiceScrollClass(opt, $(this));
|
|
$(this).data('__nicescroll', nice);
|
|
}
|
|
ret.push(nice);
|
|
});
|
|
return (ret.length == 1) ? ret[0] : ret;
|
|
};
|
|
|
|
window.NiceScroll = {
|
|
getjQuery: function() {
|
|
return jQuery
|
|
}
|
|
};
|
|
|
|
if (!$.nicescroll) {
|
|
$.nicescroll = new NiceScrollArray();
|
|
$.nicescroll.options = _globaloptions;
|
|
}
|
|
|
|
})); |